2-chloro-6-(difluoroMethoxy)pyridine
|
|
|
- CAS-Nr.
- 1214377-45-3
- Englisch Name:
- 2-chloro-6-(difluoroMethoxy)pyridine
- Synonyma:
- 2-Chloro-7-(difluoromethoxy)pyridine;2-chloro-6-(difluoroMethoxy)pyridine;Pyridine, 2-chloro-6-(difluoromethoxy)-
- CBNumber:
- CB72553691
- Summenformel:
- C6H4ClF2NO
- Molgewicht:
- 179.55
- MOL-Datei:
- 1214377-45-3.mol
|
2-chloro-6-(difluoroMethoxy)pyridine Eigenschaften
- storage temp.
- under inert gas (nitrogen or Argon) at 2-8°C
- Aussehen
- Colorless to light yellow Liquid
- InChI
- InChI=1S/C6H4ClF2NO/c7-4-2-1-3-5(10-4)11-6(8)9/h1-3,6H
- InChIKey
- MQNNYHKAEYWADV-UHFFFAOYSA-N
- SMILES
- C1(Cl)=NC(OC(F)F)=CC=C1
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H227 |
Combustible liquid |
Flammable liquids |
Category 4 |
Warnung |
|
P210, P280, P370+P378, P403+P235,P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
2-chloro-6-(difluoroMethoxy)pyridine Chemische Eigenschaften,Einsatz,Produktion Methoden
2-chloro-6-(difluoroMethoxy)pyridine Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-chloro-6-(difluoroMethoxy)pyridine Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 51)Lieferanten
- 2-chloro-6-(difluoroMethoxy)pyridine
- 2-Chloro-7-(difluoromethoxy)pyridine
- Pyridine, 2-chloro-6-(difluoromethoxy)-
- 1214377-45-3