AHK-Cu
|
|
|
- CAS-Nr.
- 682809-81-0
- Englisch Name:
- AHK-Cu
- Synonyma:
- ALA-HIS-LYS-CU;Copper Peptide 1:1;ACETYILHEXAPEPTIDE-8;AHK-Cu(2:1);ALA-HIS-LYS-CU(AHK-Cu);Copper Tripeptide-3 hydrochloride;L-Alanyl-κN-L-histidyl-κN,κN3-L-lysinato(2-)]copper Monohydrochloride
- CBNumber:
- CB74843756
- Summenformel:
- C15H24ClCuN6O4
- Molgewicht:
- 451.39
- MOL-Datei:
- 682809-81-0.mol
|
AHK-Cu Eigenschaften
- InChIKey
- ZVDTZHLNTORZAU-FBSJPIKRNA-L
- SMILES
- C([C@@H]1CC2=CNC=N2[Cu+2]2N[C@@H](C)C(=O)[N-]12)(=O)N[C@H](C(=O)[O-])CCCCN.Cl |&1:1,10,17,r|
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
AHK-Cu Chemische Eigenschaften,Einsatz,Produktion Methoden
Beschreibung
AHK-Cu, also known as Alanine-Histidine-Lysine-Copper, is a synthetic peptide that has garnered significant attention in recent years due to its potential applications in various fields, particularly in dermatology and regenerative medicine. Peptides are short chains of amino acids, and when combined with copper ions, they can exhibit unique biological activities.
AHK-Cu Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
AHK-Cu Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 80)Lieferanten
- L-Alanyl-κN-L-histidyl-κN,κN3-L-lysinato(2-)]copper Monohydrochloride
- AHK-Cu(2:1)
- ALA-HIS-LYS-CU(AHK-Cu)
- ACETYILHEXAPEPTIDE-8
- ALA-HIS-LYS-CU
- Copper Peptide 1:1
- Copper Tripeptide-3 hydrochloride
- 682809-81-0
