4-Chloro-2-cyclopropyl-6-(2-methylimidazol-1-yl)pyrimidine
|
|
|
- CAS-Nr.
- 1412958-34-9
- Englisch Name:
- 4-Chloro-2-cyclopropyl-6-(2-methylimidazol-1-yl)pyrimidine
- Synonyma:
- 4-Chloro-2-cyclopropyl-6-(2-methylimidazol-1-yl)pyrimidine;Pyrimidine, 4-chloro-2-cyclopropyl-6-(2-methyl-1H-imidazol-1-yl)-
- CBNumber:
- CB74855405
- Summenformel:
- C11H11ClN4
- Molgewicht:
- 234.68
- MOL-Datei:
- 1412958-34-9.mol
|
4-Chloro-2-cyclopropyl-6-(2-methylimidazol-1-yl)pyrimidine Eigenschaften
- Siedepunkt:
- 424.4±55.0 °C(Predicted)
- Dichte
- 1.48±0.1 g/cm3(Predicted)
- pka
- 4.01±0.69(Predicted)
- Aggregatzustand
- solid
- InChI
- 1S/C11H11ClN4/c1-7-13-4-5-16(7)10-6-9(12)14-11(15-10)8-2-3-8/h4-6,8H,2-3H2,1H3
- InChIKey
- RVODHCBMZCVNSQ-UHFFFAOYSA-N
- SMILES
- ClC1=CC(N2C(C)=NC=C2)=NC(C3CC3)=N1
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| WGK Germany |
WGK 3 |
|
|
| Speicherklasse |
6.1A - Combustible, acute toxic Cat. 1 and 2
very toxic hazardous materials |
|
|
| Hazard Classifications |
Acute Tox. 1 Dermal
Eye Irrit. 2 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H310 |
Lebensgefahr bei Hautkontakt. |
Acute toxicity,dermal |
Category 1, 2 |
Achtung |
|
P262, P264, P270, P280, P302+P350,P310, P322, P361, P363, P405, P501 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
|
| Sicherheit |
| P262 |
Nicht in die Augen, auf die Haut oder auf die Kleidung gelangen lassen. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P337+P313 |
Bei anhaltender Augenreizung: ?rztlichen Rat einholen/?rztliche Hilfe hinzuziehen. |
|
4-Chloro-2-cyclopropyl-6-(2-methylimidazol-1-yl)pyrimidine Chemische Eigenschaften,Einsatz,Produktion Methoden
4-Chloro-2-cyclopropyl-6-(2-methylimidazol-1-yl)pyrimidine Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
4-Chloro-2-cyclopropyl-6-(2-methylimidazol-1-yl)pyrimidine Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 3)Lieferanten
- 4-Chloro-2-cyclopropyl-6-(2-methylimidazol-1-yl)pyrimidine
- Pyrimidine, 4-chloro-2-cyclopropyl-6-(2-methyl-1H-imidazol-1-yl)-
- 1412958-34-9
