2-AMINO-3-FLUOROBENZONITRILE
|
|
|
- CAS-Nr.
- 115661-37-5
- Englisch Name:
- 2-AMINO-3-FLUOROBENZONITRILE
- Synonyma:
- 2-Cyano-6-fluoroaniline;Amino-3-fluorobenzonitrile;2-Amino-3-fluorobenzonitrile;Benzonitrile, 2-amino-3-fluoro-;2-Amino-3-fluorobenzonitrile,95%;2-Cyano-6-fluoroaniline, 3-Fluoroanthranilonitrile
- CBNumber:
- CB81091595
- Summenformel:
- C7H5FN2
- Molgewicht:
- 136.13
- MOL-Datei:
- 115661-37-5.mol
|
2-AMINO-3-FLUOROBENZONITRILE Eigenschaften
- Siedepunkt:
- 252.4±25.0 °C(Predicted)
- Dichte
- 1.25±0.1 g/cm3(Predicted)
- storage temp.
- under inert gas (nitrogen or Argon) at 2–8 °C
- pka
- 0.42±0.10(Predicted)
- Aggregatzustand
- Solid
- Aussehen
- Off-white to light yellow Solid
- InChI
- InChI=1S/C7H5FN2/c8-6-3-1-2-5(4-9)7(6)10/h1-3H,10H2
- InChIKey
- UNISSOLHERSZOW-UHFFFAOYSA-N
- SMILES
- C(#N)C1=CC=CC(F)=C1N
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| HazardClass |
TOXIC |
|
|
| HazardClass |
6.1 |
|
|
| HS Code |
2926907090 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
 |
P264, P270, P301+P312, P330, P501 |
| H312 |
Gesundheitssch?dlich bei Hautkontakt. |
Akute Toxizit?t dermal |
Kategorie 4 |
Warnung |
 |
P280,P302+P352, P312, P322, P363,P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H332 |
Gesundheitssch?dlich bei Einatmen. |
Akute Toxizit?t inhalativ |
Kategorie 4 |
Warnung |
 |
P261, P271, P304+P340, P312 |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P304+P340 |
BEI EINATMEN: Die Person an die frische Luft bringen und für ungehinderte Atmung sorgen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
| P405 |
Unter Verschluss aufbewahren. |
|
2-AMINO-3-FLUOROBENZONITRILE Chemische Eigenschaften,Einsatz,Produktion Methoden
Chemische Eigenschaften
brown liquid
Verwenden
2-Amino-3-fluorobenzonitrile is used as an intermediate in organic synthesis and medicinal chemistry, and is mostly used in basic chemical research and modification of pharmaceutical molecules.
2-AMINO-3-FLUOROBENZONITRILE Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-AMINO-3-FLUOROBENZONITRILE Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 149)Lieferanten
115661-37-5()Verwandte Suche:
- 2-Amino-3-fluorobenzonitrile
- 2-Cyano-6-fluoroaniline
- 2-Cyano-6-fluoroaniline, 3-Fluoroanthranilonitrile
- Benzonitrile, 2-amino-3-fluoro-
- Amino-3-fluorobenzonitrile
- 2-Amino-3-fluorobenzonitrile,95%
- 115661-37-5
- Fluorine series