3-Dehydroquinic acid potassium salt, (1R,3R,4S)-1,3,4-Trihydroxy-5-oxocyclohexanecarboxylic acid potassium salt
|
|
|
- CAS-Nr.
- 494211-79-9
- Englisch Name:
- 3-Dehydroquinic acid potassium salt, (1R,3R,4S)-1,3,4-Trihydroxy-5-oxocyclohexanecarboxylic acid potassium salt
- Synonyma:
- 5-Dehydroquinic acid potassium salt;3-Dehydroquinic acid potassium salt
;3-Dehydroquinic acid potassium salt >=97.0% (TLC);3-Dehydroquinic acid potassium salt, (1R,3R,4S)-1,3,4-Trihydroxy-5-oxocyclohexanecarboxylic acid potassium salt
- CBNumber:
- CB82100207
- Summenformel:
- C7H9O6.K
- Molgewicht:
- 228.24
- MOL-Datei:
- 494211-79-9.mol
|
3-Dehydroquinic acid potassium salt, (1R,3R,4S)-1,3,4-Trihydroxy-5-oxocyclohexanecarboxylic acid potassium salt Eigenschaften
- storage temp.
- 2-8°C
- Aggregatzustand
- powder
- Optische Rotation
- [α]/D -48.0±4.0°, c = 1.5 in H2O
- InChI
- 1S/C7H10O6.K/c8-3-1-7(13,6(11)12)2-4(9)5(3)10;/h3,5,8,10,13H,1-2H2,(H,11,12);/q;+1/p-1/t3-,5+,7-;/m1./s1
- InChIKey
- XOXNBNMEMILWBJ-HOMRGJANSA-M
- SMILES
- [K+].O[C@@H]1C[C@@](O)(CC(=O)[C@H]1O)C([O-])=O
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
T |
|
|
| R-S?tze: |
25 |
|
|
| S-S?tze: |
45 |
|
|
| RIDADR |
UN 2811 6.1 / PGIII |
|
|
| WGK Germany |
3 |
|
|
| Speicherklasse |
6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects |
|
|
| Hazard Classifications |
Acute Tox. 3 Oral |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H301 |
Giftig bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 3 |
Achtung |
|
P264, P270, P301+P310, P321, P330,P405, P501 |
|
| Sicherheit |
|
3-Dehydroquinic acid potassium salt, (1R,3R,4S)-1,3,4-Trihydroxy-5-oxocyclohexanecarboxylic acid potassium salt Chemische Eigenschaften,Einsatz,Produktion Methoden
Biochem/physiol Actions
Metabolic intermediate in the shikimate pathway; metabolite standard
3-Dehydroquinic acid potassium salt, (1R,3R,4S)-1,3,4-Trihydroxy-5-oxocyclohexanecarboxylic acid potassium salt Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
3-Dehydroquinic acid potassium salt, (1R,3R,4S)-1,3,4-Trihydroxy-5-oxocyclohexanecarboxylic acid potassium salt Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 7)Lieferanten
- 3-Dehydroquinic acid potassium salt, (1R,3R,4S)-1,3,4-Trihydroxy-5-oxocyclohexanecarboxylic acid potassium salt
- 5-Dehydroquinic acid potassium salt
- 3-Dehydroquinic acid potassium salt
- 3-Dehydroquinic acid potassium salt >=97.0% (TLC)
- 494211-79-9
- C7H9KO6
