2-Fluoro-6-methoxypyridin-3-ylboronic acid
|
|
|
- CAS-Nr.
- 1402238-30-5
- Englisch Name:
- 2-Fluoro-6-methoxypyridin-3-ylboronic acid
- Synonyma:
- 2-Fluoro-6-methoxypyridine-3-boronic acid;2-Fluoro-6-methoxypyridin-3-ylboronic acid;Boronic acid, B-(2-fluoro-6-methoxy-3-pyridinyl)-;2-fluoro-6-methoxypyridine-3-boronic acid - [F82745];(2-Fluoro-6-methoxypyridin-3-yl)boronic acid(contains varying amounts of Anhydride)
- CBNumber:
- CB82517311
- Summenformel:
- C6H7BFNO3
- Molgewicht:
- 170.93
- MOL-Datei:
- 1402238-30-5.mol
|
2-Fluoro-6-methoxypyridin-3-ylboronic acid Eigenschaften
- Siedepunkt:
- 307.3±52.0 °C(Predicted)
- Dichte
- 1.34±0.1 g/cm3(Predicted)
- storage temp.
- Refrigerated.
- pka
- 7.05±0.58(Predicted)
- Aussehen
- White to off-white Solid
- InChI
- InChI=1S/C6H7BFNO3/c1-12-5-3-2-4(7(10)11)6(8)9-5/h2-3,10-11H,1H3
- InChIKey
- WSWYXLGQQAESDV-UHFFFAOYSA-N
- SMILES
- B(C1=CC=C(OC)N=C1F)(O)O
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
 |
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P270 |
Bei Gebrauch nicht essen, trinken oder rauchen. |
| P271 |
Nur im Freien oder in gut belüfteten R?umen verwenden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P302+P352 |
BEI BERüHRUNG MIT DER HAUT: Mit viel Wasser/... (Hersteller kann, falls zweckm??ig, ein Reinigungsmittel angeben oder, wenn Wasser eindeutig ungeeignet ist, ein alternatives Mittel empfehlen) waschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
| P332+P313 |
Bei Hautreizung: ?rztlichen Rat einholen/?rztliche Hilfe hinzuziehen. |
| P337+P313 |
Bei anhaltender Augenreizung: ?rztlichen Rat einholen/?rztliche Hilfe hinzuziehen. |
|
2-Fluoro-6-methoxypyridin-3-ylboronic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
2-Fluoro-6-methoxypyridin-3-ylboronic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-Fluoro-6-methoxypyridin-3-ylboronic acid Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 38)Lieferanten
- 2-Fluoro-6-methoxypyridin-3-ylboronic acid
- 2-Fluoro-6-methoxypyridine-3-boronic acid
- Boronic acid, B-(2-fluoro-6-methoxy-3-pyridinyl)-
- (2-Fluoro-6-methoxypyridin-3-yl)boronic acid(contains varying amounts of Anhydride)
- 2-fluoro-6-methoxypyridine-3-boronic acid - [F82745]
- 1402238-30-5