Cabozantinib impurity 1
|
|
|
- CAS-Nr.
- 748707-58-6
- Englisch Name:
- Cabozantinib impurity 1
- Synonyma:
- 4-((6,7-dimethoxyquinolin-4-yl)amino)phenol;Cabozantinib Impurity KBT-M1Z02;Pyrido[3,2-d]pyrimidine-2,4(1H,3H)-dione, 7-
bromo-;Phenol, 4-?[(6,?7-?dimethoxy-?4-?quinolinyl)?amino]?-;4-((6,7-dimethoxyquinolin-4-yl)amino)phenol hydrochloride;4-((6,7-dimethoxyquinolin-4-yl)amino)phenolQ: What is
4-((6,7-dimethoxyquinolin-4-yl)amino)phenol Q: What is the CAS Number of
4-((6,7-dimethoxyquinolin-4-yl)amino)phenol
- CBNumber:
- CB83154942
- Summenformel:
- C17H16N2O3
- Molgewicht:
- 296.32
- MOL-Datei:
- 748707-58-6.mol
|
Cabozantinib impurity 1 Eigenschaften
- storage temp.
- 2-8°C, protect from light, stored under nitrogen
- Aussehen
- Light yellow to yellow Solid
- InChI
- InChI=1S/C17H16N2O3/c1-21-16-9-13-14(19-11-3-5-12(20)6-4-11)7-8-18-15(13)10-17(16)22-2/h3-10,20H,1-2H3,(H,18,19)
- InChIKey
- AQNXHBFSMBNESC-UHFFFAOYSA-N
- SMILES
- C1(O)=CC=C(NC2C3C(N=CC=2)=CC(OC)=C(OC)C=3)C=C1
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
Cabozantinib impurity 1 Chemische Eigenschaften,Einsatz,Produktion Methoden
Cabozantinib impurity 1 Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
Cabozantinib impurity 1 Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 41)Lieferanten
- Phenol, 4-?[(6,?7-?dimethoxy-?4-?quinolinyl)?amino]?-
- Pyrido[3,2-d]pyrimidine-2,4(1H,3H)-dione, 7-
bromo-
- Cabozantinib Impurity KBT-M1Z02
- 4-((6,7-dimethoxyquinolin-4-yl)amino)phenol hydrochloride
- 4-((6,7-dimethoxyquinolin-4-yl)amino)phenolQ: What is
4-((6,7-dimethoxyquinolin-4-yl)amino)phenol Q: What is the CAS Number of
4-((6,7-dimethoxyquinolin-4-yl)amino)phenol
- 4-((6,7-dimethoxyquinolin-4-yl)amino)phenol
- 748707-58-6
