4(tert-Butoxycarbonyl-N-methylamino)-phenylboronic acid
|
|
|
- CAS-Nr.
- 945756-49-0
- Englisch Name:
- 4(tert-Butoxycarbonyl-N-methylamino)-phenylboronic acid
- Synonyma:
- (4-((tert-Butoxycarbonyl)(Methyl)aMino)phenyl)boronic acid;4(tert-Butoxycarbonyl-N-methylamino)-phenylboronic acid;4-(tert-Butoxycarbonyl-N-methylamino)phenylboronic acid AldrichCPR;[4-[tert-butoxycarbonyl(methyl)amino]phenyl]boronic acid - [B88030];4-(tert-Butoxycarbonyl-N-methylamino)phenylboronic acid;4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid;Carbamic acid, N-(4-boronophenyl)-N-methyl-, C-(1,1-dimethylethyl) ester
- CBNumber:
- CB91113263
- Summenformel:
- C12H18BNO4
- Molgewicht:
- 251.09
- MOL-Datei:
- 945756-49-0.mol
|
4(tert-Butoxycarbonyl-N-methylamino)-phenylboronic acid Eigenschaften
- storage temp.
- Inert atmosphere,Store in freezer, under -20°C
- Aggregatzustand
- solid
- Aussehen
- Off-white to light yellow Solid
- InChI
- 1S/C12H18BNO4/c1-12(2,3)18-11(15)14(4)10-7-5-9(6-8-10)13(16)17/h5-8,16-17H,1-4H3
- InChIKey
- IPRHVYYSYKNJDE-UHFFFAOYSA-N
- SMILES
- OB(O)C1=CC=C(N(C(OC(C)(C)C)=O)C)C=C1
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xi |
|
|
| R-S?tze: |
43 |
|
|
| S-S?tze: |
36/37 |
|
|
| WGK Germany |
3 |
|
|
| HS Code |
2931900090 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Skin Sens. 1 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H317 |
Kann allergische Hautreaktionen verursachen. |
Sensibilisierung der Haut |
Kategorie 1A |
Warnung |
|
P261, P272, P280, P302+P352,P333+P313, P321, P363, P501 |
|
| Sicherheit |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
|
4(tert-Butoxycarbonyl-N-methylamino)-phenylboronic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
4(tert-Butoxycarbonyl-N-methylamino)-phenylboronic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
4(tert-Butoxycarbonyl-N-methylamino)-phenylboronic acid Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 32)Lieferanten
- 4(tert-Butoxycarbonyl-N-methylamino)-phenylboronic acid
- 4-(tert-Butoxycarbonyl-N-methylamino)phenylboronic acid AldrichCPR
- Carbamic acid, N-(4-boronophenyl)-N-methyl-, C-(1,1-dimethylethyl) ester
- 4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid
- 4-(tert-Butoxycarbonyl-N-methylamino)phenylboronic acid
- [4-[tert-butoxycarbonyl(methyl)amino]phenyl]boronic acid - [B88030]
- (4-((tert-Butoxycarbonyl)(Methyl)aMino)phenyl)boronic acid
- 945756-49-0
