7-Bromoindole-2-carboxylic acid
|
|
|
- CAS-Nr.
- 16732-71-1
- Englisch Name:
- 7-Bromoindole-2-carboxylic acid
- Synonyma:
- 7-BROMO-1H-INDOLE-2-CARBOXYLIC ACID;7-BROMO-2-INDOLECARBOXYLIC ACID;7-BROMOINDOLE-2-CARBOXYLIC ACID;(2Z)-2-hexylidene-1-cyclohexanone;1H-Indole-2-carboxylic acid, 7-bromo-
- CBNumber:
- CB9143939
- Summenformel:
- C9H6BrNO2
- Molgewicht:
- 240.05
- MOL-Datei:
- 16732-71-1.mol
|
7-Bromoindole-2-carboxylic acid Eigenschaften
- Schmelzpunkt:
- 238-243°C
- Siedepunkt:
- 470.9±25.0 °C(Predicted)
- Dichte
- 1.838±0.06 g/cm3(Predicted)
- storage temp.
- 2-8°C
- Aggregatzustand
- solid
- pka
- 4.22±0.30(Predicted)
- Aussehen
- White to light yellow Solid
- InChI
- 1S/C9H6BrNO2/c10-6-3-1-2-5-4-7(9(12)13)11-8(5)6/h1-4,11H,(H,12,13)
- InChIKey
- ZKGMXVLKFBRKNN-UHFFFAOYSA-N
- SMILES
- OC(C1=CC2=C(N1)C(Br)=CC=C2)=O
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xi |
|
|
| R-S?tze: |
36/38 |
|
|
| S-S?tze: |
26 |
|
|
| WGK Germany |
3 |
|
|
| HS Code |
2933998090 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Eye Irrit. 2
Skin Irrit. 2 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
|
| Sicherheit |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P302+P352 |
BEI BERüHRUNG MIT DER HAUT: Mit viel Wasser/... (Hersteller kann, falls zweckm??ig, ein Reinigungsmittel angeben oder, wenn Wasser eindeutig ungeeignet ist, ein alternatives Mittel empfehlen) waschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
| P332+P313 |
Bei Hautreizung: ?rztlichen Rat einholen/?rztliche Hilfe hinzuziehen. |
| P337+P313 |
Bei anhaltender Augenreizung: ?rztlichen Rat einholen/?rztliche Hilfe hinzuziehen. |
|
7-Bromoindole-2-carboxylic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
Verwenden
7-Bromoindole-2-carboxylic acid is an organic compound that is often used as a synthetic intermediate for drugs, dyes, and other chemical products.
7-Bromoindole-2-carboxylic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
7-Bromoindole-2-carboxylic acid Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 142)Lieferanten
16732-71-1()Verwandte Suche:
- 7-BROMOINDOLE-2-CARBOXYLIC ACID
- 7-BROMO-2-INDOLECARBOXYLIC ACID
- (2Z)-2-hexylidene-1-cyclohexanone
- 1H-Indole-2-carboxylic acid, 7-bromo-
- 7-BROMO-1H-INDOLE-2-CARBOXYLIC ACID
- 16732-71-1
