Mebendazole-d3
|
|
|
- CAS-Nr.
- 1173021-87-8
- Englisch Name:
- Mebendazole-d3
- Synonyma:
- D3-Mebendazole;Mebendazole-d3;Mebendazole-d3;Mebendazole D3Q: What is
Mebendazole D3 Q: What is the CAS Number of
Mebendazole D3 Q: What is the storage condition of
Mebendazole D3 Q: What are the applications of
Mebendazole D3
- CBNumber:
- CB92545308
- Summenformel:
- C16H12N3O3
- Molgewicht:
- 294.28478
- MOL-Datei:
- 1173021-87-8.mol
|
Mebendazole-d3 Eigenschaften
- L?slichkeit
- DMSO (Slightly), Methanol (Very Slightly, Heated, Sonicated)
- Major Application
- forensics and toxicology
pharmaceutical (small molecule)
- InChI
- 1S/C16H13N3O3/c1-22-16(21)19-15-17-12-8-7-11(9-13(12)18-15)14(20)10-5-3-2-4-6-10/h2-9H,1H3,(H2,17,18,19,21)/i1D3
- InChIKey
- OPXLLQIJSORQAM-FIBGUPNXSA-N
- SMILES
- [2H]C([2H])([2H])OC(=O)Nc1nc2cc(ccc2[nH]1)C(=O)c3ccccc3
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xn |
|
|
| R-S?tze: |
22 |
|
|
| S-S?tze: |
36 |
|
|
| WGK Germany |
3 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Acute Tox. 4 Oral |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
|
| Sicherheit |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P270 |
Bei Gebrauch nicht essen, trinken oder rauchen. |
| P301+P312 |
BEI VERSCHLUCKEN: Bei Unwohlsein GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
| P501 |
Inhalt/Beh?lter ... (Entsorgungsvorschriften vom Hersteller anzugeben) zuführen. |
|
Mebendazole-d3 Chemische Eigenschaften,Einsatz,Produktion Methoden
Verwenden
(Mebendazole-d3) Labeled Mebendazole, intended for use as an internal standard for the quantification of Mebendazole by GC- or LC-mass spectrometry.
Mebendazole-d3 Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
Mebendazole-d3 Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 29)Lieferanten
1173021-87-8()Verwandte Suche:
- Mebendazole-d3
- D3-Mebendazole
- Mebendazole D3Q: What is
Mebendazole D3 Q: What is the CAS Number of
Mebendazole D3 Q: What is the storage condition of
Mebendazole D3 Q: What are the applications of
Mebendazole D3
- Mebendazole-d3
- 1173021-87-8
- C16H5D8N3O3
- Amines
- Aromatics
- Heterocycles
- Intermediates & Fine Chemicals
- Isotope Labelled Compounds
- Pharmaceuticals
