(S)-Morpholine-3-carboxylic acid HCl
|
|
|
- CAS-Nr.
- 1187929-04-9
- Englisch Name:
- (S)-Morpholine-3-carboxylic acid HCl
- Synonyma:
- (S)-Morpholine-3-carboxylic acid HCl;(3S)-Morpholine-3-carboxylicacidhydrochloride;(S)-Morpholine-3-carboxylic acid hydrochloride;3-Morpholinecarboxylic acid, hydrochloride, (3S)-;(3S)-3-Morpholinecarboxylic acid hydrochloride (1:1);(S)-Morpholine-3-carboxylic acid HCl (Related Reference)
- CBNumber:
- CB92660409
- Summenformel:
- C5H10ClNO3
- Molgewicht:
- 167.59
- MOL-Datei:
- 1187929-04-9.mol
|
(S)-Morpholine-3-carboxylic acid HCl Eigenschaften
- storage temp.
- under inert gas (nitrogen or Argon) at 2-8°C
- Aussehen
- White to off-white Solid
- Optische Rotation
- Consistent with structure
- InChI
- InChI=1/C5H9NO3.ClH/c7-5(8)4-3-9-2-1-6-4;/h4,6H,1-3H2,(H,7,8);1H/t4-;/s3
- InChIKey
- CWSLARZELUGARZ-NDILARRWNA-N
- SMILES
- C([C@H]1NCCOC1)(=O)O.Cl |&1:1,r|
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H332 |
Gesundheitssch?dlich bei Einatmen. |
Akute Toxizit?t inhalativ |
Kategorie 4 |
Warnung |
|
P261, P271, P304+P340, P312 |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
(S)-Morpholine-3-carboxylic acid HCl Chemische Eigenschaften,Einsatz,Produktion Methoden
(S)-Morpholine-3-carboxylic acid HCl Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
(S)-Morpholine-3-carboxylic acid HCl Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 69)Lieferanten
- (S)-Morpholine-3-carboxylic acid HCl
- (S)-Morpholine-3-carboxylic acid hydrochloride
- (3S)-3-Morpholinecarboxylic acid hydrochloride (1:1)
- (3S)-Morpholine-3-carboxylicacidhydrochloride
- (S)-Morpholine-3-carboxylic acid HCl (Related Reference)
- 3-Morpholinecarboxylic acid, hydrochloride, (3S)-
- 1187929-04-9
