4-Bromo-2-(trifluoromethyl)benzenesulfonyl chloride
|
|
|
- CAS-Nr.
- 176225-10-8
- Englisch Name:
- 4-Bromo-2-(trifluoromethyl)benzenesulfonyl chloride
- Synonyma:
- BUTTPARK 99\11-48;4-Bromo-2-(trifluoro;4-Bromo-2-(trifluoromet;4-Bromo-2-(trifluoromethyl)benzene chlor;5-Bromo-2-(chlorosulphonyl)benzotrifluoride;4-bromo-2-(trifluoromethyl)phenylsulfonyl chloride;-Bromo-2-(trifluoromethyl)benzenesulfonyl chloride;4-BROMO-2-(TRIFLUOROMETHYL)BENZENESULFONYL CHLORIDE;4-BROMO-2-(TRIFLUOROMETHYL)BENZENESULPHONYL CHLORIDE;4-Bromo-2-(trifluoromethyl)benzene chlorosulphonamide
- CBNumber:
- CB9272349
- Summenformel:
- C7H3BrClF3O2S
- Molgewicht:
- 323.51
- MOL-Datei:
- 176225-10-8.mol
|
4-Bromo-2-(trifluoromethyl)benzenesulfonyl chloride Eigenschaften
- Schmelzpunkt:
- 54-58 °C (lit.)
- Siedepunkt:
- 285.6±40.0 °C(Predicted)
- Dichte
- 1.840±0.06 g/cm3(Predicted)
- Flammpunkt:
- >230 °F
- storage temp.
- Inert atmosphere,Room Temperature
- Aggregatzustand
- crystalline powder
- Farbe
- Faint yellow to light orange
- Sensitive
- Moisture Sensitive
- InChI
- 1S/C7H3BrClF3O2S/c8-4-1-2-6(15(9,13)14)5(3-4)7(10,11)12/h1-3H
- InChIKey
- YFXYEMZYOMNQLD-UHFFFAOYSA-N
- SMILES
- FC(F)(F)c1cc(Br)ccc1S(Cl)(=O)=O
- CAS Datenbank
- 176225-10-8(CAS DataBase Reference)
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
C,Xi |
|
|
| R-S?tze: |
34 |
|
|
| S-S?tze: |
26-36/37/39-45 |
|
|
| RIDADR |
UN 3261 8/PG 2 |
|
|
| WGK Germany |
3 |
|
|
| Hazard Note |
Irritant |
|
|
| HazardClass |
8 |
|
|
| PackingGroup |
III |
|
|
| HS Code |
29049090 |
|
|
| Speicherklasse |
8A - Combustible corrosive hazardous materials |
|
|
| Hazard Classifications |
Eye Dam. 1 Skin Corr. 1B |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H314 |
Verursacht schwere Ver?tzungen der Haut und schwere Augensch?den. |
?tzwirkung auf die Haut |
Kategorie 1B |
Achtung |
 |
P260,P264, P280, P301+P330+ P331,P303+P361+P353, P363, P304+P340,P310, P321, P305+ P351+P338, P405,P501 |
| H318 |
Verursacht schwere Augensch?den. |
Schwere Augensch?digung |
Kategorie 1 |
Achtung |
 |
P280, P305+P351+P338, P310 |
|
| Sicherheit |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P301+P330+P331 |
BEI VERSCHLUCKEN: Mund ausspülen. KEIN Erbrechen herbeiführen. |
| P303+P361+P353 |
BEI BERüHRUNG MIT DER HAUT (oder dem Haar): Alle kontaminierten Kleidungsstücke sofort ausziehen. Haut mit Wasser abwaschen oder duschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
| P310 |
Sofort GIFTINFORMATIONSZENTRUM/Arzt/ anrufen. |
| P405 |
Unter Verschluss aufbewahren. |
|
4-Bromo-2-(trifluoromethyl)benzenesulfonyl chloride Chemische Eigenschaften,Einsatz,Produktion Methoden
R-S?tze Betriebsanweisung:
R34:Verursacht Ver?tzungen.
S-S?tze Betriebsanweisung:
S26:Bei Berührung mit den Augen sofort gründlich mit Wasser abspülen und Arzt konsultieren.
S36/37/39:Bei der Arbeit geeignete Schutzkleidung,Schutzhandschuhe und Schutzbrille/Gesichtsschutz tragen.
S45:Bei Unfall oder Unwohlsein sofort Arzt zuziehen (wenn m?glich, dieses Etikett vorzeigen).
4-Bromo-2-(trifluoromethyl)benzenesulfonyl chloride Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
4-Bromo-2-(trifluoromethyl)benzenesulfonyl chloride Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 142)Lieferanten
176225-10-8()Verwandte Suche:
- BUTTPARK 99\11-48
- 4-BROMO-2-(TRIFLUOROMETHYL)BENZENESULPHONYL CHLORIDE
- 4-BROMO-2-(TRIFLUOROMETHYL)BENZENE-1-SULFONYL CHLORIDE
- 4-BROMO-2-(TRIFLUOROMETHYL)BENZENESULFONYL CHLORIDE
- 4-Bromo-2-(trifluoromethyl)benzene chlorosulphonamide
- 4-Bromo-2-(trifluoromethyl)benzenesulphonylchloride98%
- 4-BroMo-2-(trifluoroMethyl)benzenesulfonyl chloride
- Benzenesulfonyl chloride, 4-broMo-2-(trifluoroMethyl)-
- 4-BroMo-2-(trifluoroMethyl)benzenesulfonyl chloride 97%
- 4-Bromo-2-(trifluoromet
- 4-Bromo-2-(trifluoro
- 5-Bromo-2-(chlorosulphonyl)benzotrifluoride
- 4-bromo-2-(trifluoromethyl)phenylsulfonyl chloride
- 4-Bromo-2-(trifluoromethyl)benzene chlor
- -Bromo-2-(trifluoromethyl)benzenesulfonyl chloride
- 176225-10-8
- Organic Building Blocks
- Sulfonyl Halides
- Sulfur Compounds
- Building Blocks
- Fluorine series
- Fluorobenzene
- Organic Building Blocks
- Sulfonyl Halides
- Sulfur Compounds