??3-??????????
|
|
??3-?????????? ??
- InChI
- InChI=1S/C4H8O3.K.H/c1-3(5)2-4(6)7;;/h3,5H,2H2,1H3,(H,6,7);;
- InChIKey
- RFGCOONEEVJESX-UHFFFAOYSA-N
- SMILES
- C(C(=O)O)C(O)C.[KH]
??
- ?? ? ?? ??
- ?? ? ???? ?? (GHS)
| ????(GHS): |
|
|||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| ?? ?: | Warning | |||||||||||||||||||||||||||||||||||
| ??·?? ??: |
|
|||||||||||||||||||||||||||||||||||
| ??????: |
|
??3-?????????? C??? ??, ??, ??
?? ??
Ethyl (R)-3-hydroxybutyrate (88.4 g) and water (300 ml) were added to a three-vial bottle. Potassium hydroxide (37.5g) was slowly added in batches within 3 hours and the temperature is 10 °C. After 2 hours, add activated carbon (0.3g ) to the mixtrue. Continue the reaction for 10 minutes and then filter the reaction solution. The filtrate was concentrated to 100 ml. Stir for 1h to room temperature. After centrifugation and vacuum drying, white solid (potassium 3-hydroxybutyrate) was obtained. Yield=88.2%.
??3-?????????? ?? ?? ? ???
???
?? ??
??3-?????????? ?? ??
???( 74)?? ??
| ??? | ?? | ??? | ?? | ?? ? | ?? |
|---|---|---|---|---|---|
| GIHI CHEMICALS CO.,LIMITED | +86-571-86217390; +8618058761490 |
info@gihichemicals.com | China | 49895 | 58 |
| Hebei Yanxi Chemical Co., Ltd. | +86-17531190177 |
faithe@yan-xi.com | China | 5853 | 58 |
| Hebei Chuanghai Biotechnology Co,.LTD | +86-86-13131129325 |
sales1@chuanghaibio.com | China | 5218 | 58 |
| Hebei Chuanghai Biotechnology Co., Ltd | +86-17732866630 |
mina@chuanghaibio.com | China | 18126 | 58 |
| airuikechemical co., ltd. | +86-18353166132 |
sales02@airuikechemical.com | China | 983 | 58 |
| QINGDAO HONG JIN CHEMCIAL CO.,LTD. | +86-86-532-83657313 +86-18663969289 |
hjt@hong-jin.com | China | 225 | 58 |
| Shandong chuangyingchemical Co., Ltd. | 18853181302 |
sale@chuangyingchem.com | CHINA | 5906 | 58 |
| career henan chemical co | +86-0371-86658258 |
factory@coreychem.com | China | 29792 | 58 |
| Tangshan Moneide Trading Co., Ltd. | +86-315-8309571 +86-15633399667 |
sales@moneidechem.com | China | 574 | 58 |
| Hefei TNJ Chemical Industry Co.,Ltd. | +86-0551-65418671 +86-189 4982 3763 |
sales@tnjchem.com | China | 34563 | 58 |
??3-?????????? ?? ??:
??-???-N-??? ? Methyl (R)-(-)-3-hydroxybuty?? e
DL-3-Hydroxybutyric acid monosodium salt
Ethanol
Oxalic acid dihydrate
Pyrimidine
Glutaric acid
butyl 3-hydroxybutyrate
ETHYL 3-HYDROXYBUTYRATE
3-hydroxybutyric acid
Ethyl 3-hydroxybutyrate
methyl 3-hydroxybutyrate
(R)-(-)-3-HYDROXYBUTYRIC ACID, SODIUM SALT
3-Hydroxybutanoic acid magnesium salt
3-Hydroxybutanoic acid calcium salt
magnesium 3-hydroxybutyrate
Calcium 3-hydroxybutyrate
3-Hydroxybutyric acid