Diisooctylthiophosphinic acid
Diisooctylthiophosphinic acid ??
- ?? ?
- 361.0±25.0 °C(Predicted)
- ??
- 0.93 g/mL at 20 °C(lit.)
- ???
- n20/D 1.48
- ???
- 96 °C
- ?? ??
- Hygroscopic, Refrigerator, under inert atmosphere
- ???
- ?????(?? ???), ???(?? ???, ?????)
- ??? ??
- ??
- ?? ?? (pKa)
- 4.45±0.10(Predicted)
- ??
- ?? ????? ?? ????
- InChI
- 1S/C16H35OPS/c1-13(9-15(3,4)5)11-18(17,19)12-14(2)10-16(6,7)8/h13-14H,9-12H2,1-8H3,(H,17,19)
- InChIKey
- KUYLHALFMPOMKK-UHFFFAOYSA-N
- SMILES
- CC(CC(C)(C)C)CP(S)(=O)CC(C)CC(C)(C)C
- EPA
- Phosphinothioic acid, bis(2,4,4-trimethylpentyl)- (132767-86-3)
??
- ?? ? ?? ??
- ?? ? ???? ?? (GHS)
| ??? ?? |
C |
|
|
| ?? ???? ?? |
34 |
|
|
| ????? |
26-36/37/39-45 |
|
|
| ????(UN No.) |
UN 3265 8/PG 2 |
|
|
| WGK ?? |
3 |
|
|
| TSCA |
TSCA listed |
|
|
| ?? ?? |
8 |
|
|
| ???? |
III |
|
|
| ???? ??? |
8A - Combustible corrosive hazardous materials |
|
|
| Hazard Classifications |
Skin Corr. 1B |
|
|
| ????(GHS): |
|
| ?? ?: |
Danger |
| ??·?? ??: |
| ?? |
??·?? ?? |
?? ?? |
?? |
?? ? |
?? ?? |
P- ?? |
| H314 |
??? ?? ??? ?? ??? ??? |
????? ?? ????? |
?? 1A, B, C |
?? |
|
P260,P264, P280, P301+P330+ P331,P303+P361+P353, P363, P304+P340,P310, P321, P305+ P351+P338, P405,P501 |
|
| ??????: |
| P280 |
????/???/???/?????? ?????. |
| P303+P361+P353 |
??(?? ????)? ??? ??? ?? ??? ??? ????? ??? ?? ????/?????. |
| P305+P351+P338 |
?? ??? ? ?? ?? ???? ????. ???? ?????? ?????. ?? ????. |
| P363 |
?? ??? ??? ??? ?????. |
| P405 |
???? ?????. |
|
Diisooctylthiophosphinic acid C??? ??, ??, ??
??
Diisooctylthiophosphinic Acid is a cyanex 302 metal complex with antibacterial and antifungal activities.
?? ??
Diisooctylthiophosphinic acid is an application specific reagent.
Diisooctylthiophosphinic acid ?? ?? ? ???
???
?? ??
Diisooctylthiophosphinic acid ?? ??
???( 41)?? ??
Diisooctylthiophosphinic acid ?? ??:
