????????????
???????????? ??
- ???
- 160°C
- ?? ??
- Sealed in dry,Room Temperature
- ???
- DMSO(?? ???), ???(?? ???)
- ??? ??
- Solid
- ??
- ???? ?????
- ?? ??
- ???(???)
- InChI
- InChI=1S/C12H14N2.ClH/c1-9-4-3-5-11(10(9)2)6-12-7-13-8-14-12;/h3-5,7-8H,6H2,1-2H3,(H,13,14);1H
- InChI
- 1S/C12H14N2.ClH/c1-9-4-3-5-11(10(9)2)6-12-7-13-8-14-12;/h3-5,7-8H,6H2,1-2H3,(H,13,14);1H
- InChIKey
- OIWRDXKNDCJZSM-UHFFFAOYSA-N
- SMILES
- [Cl-].[nH]1cncc1Cc2c(c(ccc2)C)C.[H+]
- SMILES
- C1(C=CC=C(C)C=1C)CC1N=CNC=1.Cl
??
- ?? ? ?? ??
- ?? ? ???? ?? (GHS)
| ????(UN No.) |
UN 2811 6.1 / PGIII |
|
|
| WGK ?? |
WGK 3 |
|
|
| RTECS ?? |
NI5160000 |
|
|
| HS ?? |
2933.29.4300 |
|
|
| ???? ??? |
11 - Combustible Solids |
|
|
| ????(GHS): |
|
| ?? ?: |
Danger |
| ??·?? ??: |
| ?? |
??·?? ?? |
?? ?? |
?? |
?? ? |
?? ?? |
P- ?? |
| H301 |
??? ??? |
?? ?? ?? - ?? |
?? 3 |
?? |
|
P264, P270, P301+P310, P321, P330,P405, P501 |
| H311 |
??? ???? ??? |
?? ?? ?? - ?? |
?? 3 |
?? |
|
P280, P302+P352, P312, P322, P361,P363, P405, P501 |
| H331 |
???? ??? |
?? ?? ?? ?? |
?? 3 |
?? |
|
P261, P271, P304+P340, P311, P321,P403+P233, P405, P501 |
|
| ??????: |
| P261 |
??·?·??·???·??·...·????? ??? ????. |
| P264 |
?? ??? ?? ??? ????. |
| P264 |
?? ??? ?? ??? ????. |
| P270 |
? ??? ??? ??? ???, ???? ???? ???. |
| P271 |
?? ?? ??? ? ?? ???? ?????. |
| P280 |
????/???/???/?????? ?????. |
| P301+P310 |
???? ?? ????(??)? ??? ????. |
| P302+P352 |
??? ??? ??? ?? ????. |
| P304+P340 |
???? ??? ??? ?? ??? ??? ???? ?? ??? ??? ????. |
| P311 |
????(??)? ??? ????. |
| P312 |
???? ??? ????(??)? ??? ????. |
| P321 |
(…) ??? ???. |
| P322 |
?? ??(??? … ??) |
| P330 |
?? ?????. |
| P361 |
?? ??? ??? ?? ?? ? |
| P363 |
?? ??? ??? ??? ?????. |
| P403+P233 |
??? ??? ? ?? ?? ??? ???? ?????. |
| P405 |
???? ?????. |
| P501 |
...? ??? / ??? ?? ???. |
|
| NFPA 704 |
|
|
|
???????????? C??? ??, ??, ??
??? ??
Off-White Solid
??
Detomidine Hydrochloride is an α-Adrenoceptor agonist with sedative and analgesic activity. Sedative.
Veterinary Drugs and Treatments
At present, detomidine is only approved for use as a sedative analgesic
in horses, but it has been used clinically in other species.
???????????? ?? ?? ? ???
???
?? ??
???????????? ?? ??
???( 277)?? ??
