???
|
|
??? ??
- ?? ??
- Inert atmosphere,Room Temperature
- ???
- insoluble in H2O
- ??
- crystals, crystalline
- ???
- ?? ???
- ???
- ????. ??? ???? ????.
- InChI
- InChI=1S/CH2O3.Cu/c2-1(3)4;/h(H2,2,3,4);
- InChIKey
- OVFCVRIJCCDFNQ-UHFFFAOYSA-N
- SMILES
- C(O)(O)=O.[Cu]
- LogP
- -0.809 (est)
??
- ?? ? ?? ??
- ?? ? ???? ?? (GHS)
| TSCA | TSCA listed | ||
|---|---|---|---|
| ?? ?? ??? | 1184-64-1(Hazardous Substances Data) | ||
| ???? ?? | KE-08906 |
| ????(GHS): |
 
|
||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| ?? ?: | Warning | ||||||||||||||||||||||||||||
| ??·?? ??: |
|
||||||||||||||||||||||||||||
| ??????: |
|
??? C??? ??, ??, ??
??? ??
green or blue powder??
Copper(I) carbonate is known as cuprous carbonate since copper’s ion is +1; copper(II) carbonate (Cu2+ + CO3 2- → CuCO3) is known as cupric carbonate, which is also known as the green copper mineral malachite, used in pigments, as an insecticide, as a cosmetic astringent, and as a plant fungicide to prevent smut.??? ?? ?? ? ???
???
?? ??
??? ?? ??
???( 137)?? ??
| ??? | ?? | ??? | ?? | ?? ? | ?? |
|---|---|---|---|---|---|
| Hebei Chuanghai Biotechnology Co., Ltd | +86-15350571055 |
Sibel@chuanghaibio.com | China | 8738 | 58 |
| Henan Tianfu Chemical Co.,Ltd. | +86-0371-55170693 +86-19937530512 |
info@tianfuchem.com | China | 21585 | 55 |
| career henan chemical co | +86-0371-86658258 |
factory@coreychem.com | China | 29792 | 58 |
| Hefei TNJ Chemical Industry Co.,Ltd. | +86-0551-65418671 +86-189 4982 3763 |
sales@tnjchem.com | China | 34563 | 58 |
| ANHUI WITOP BIOTECH CO., LTD | +8618071025641 |
eric@witopchemical.com | China | 23541 | 58 |
| Guangzhou TongYi biochemistry technology Co.,LTD | |
tongyibiochem@163.com | China | 2995 | 58 |
| LUYUNJIA CHEMISTRY XIAMEN LIMITED | +86-592-5360779 +86-13055435203 |
China | 5988 | 58 | |
| PT CHEM GROUP LIMITED | +86-85511178; +86-85511178 |
peter68@ptchemgroup.com | China | 35425 | 58 |
| ZHEJIANG JIUZHOU CHEM CO., LTD | +86-0576225566889 +86-13454675544 |
admin@jiuzhou-chem.com；jamie@jiuzhou-chem.com；alice@jiuzhou-chem.com | China | 12272 | 58 |
| SUZHOU SENFEIDA CHEMICAL CO.,LTD | +86-0512-83500002 +86-15195660023 |
3899766280@qq.com | China | 26362 | 58 |
??? ?? ??:
??????? ?? ?? ?? ?? ???(I) ????(I) ?? ?II??
Copper(II) chloride dihydrate
Zinc acetate dihydrate
Zinc sulfate heptahydrate
PolycarbodiiMide
Strontium carbonate
YtterbiuM(III) Carbonate Hydrate
Cesium carbonate
SAMARIUM CARBONATE
bis(1-chloroethyl) carbonate
Carbohydrazide
YTTRIUM CARBONATE
Cerium(III) carbonate hydrate