Ethyl cyanoglyoxylate-2-oxime
Ethyl cyanoglyoxylate-2-oxime ??
- ???
- 130-132 °C (lit.)
- ?? ?
- 259.65°C (rough estimate)
- ??
- 1.4801 (rough estimate)
- ???
- 1.5090 (estimate)
- ?? ??
- Store at +2°C to +8°C.
- ???
- DMSO(?? ???), ???(?? ???)
- ??? ??
- ??
- ??? ??
- ??? ??
- ?? ?? (pKa)
- 6.18±0.10(Predicted)
- ??
- ???
- BRN
- 774783
- ?? ??
- ???? ??
- InChI
- InChI=1S/C5H6N2O3/c1-2-10-5(8)4(3-6)7-9/h9H,2H2,1H3
- InChIKey
- LCFXLZAXGXOXAP-QPJJXVBHSA-N
- SMILES
- C(OCC)(=O)C(C#N)=NO
- CAS ??????
- 3849-21-6(CAS DataBase Reference)
??
- ?? ? ?? ??
- ?? ? ???? ?? (GHS)
| ??? ?? |
Xn,Xi |
|
|
| ?? ???? ?? |
20/21/22 |
|
|
| ????? |
22-24/25-36/37 |
|
|
| ????(UN No.) |
3276 |
|
|
| WGK ?? |
3 |
|
|
| F ?????? |
10 |
|
|
| ?? ?? ?? |
Irritant |
|
|
| HS ?? |
2928 00 90 |
|
|
| ?? ?? |
6.1 |
|
|
| ???? |
III |
|
|
| ???? ??? |
11 - Combustible Solids |
|
|
| ????(GHS): |
|
| ?? ?: |
Warning |
| ??·?? ??: |
| ?? |
??·?? ?? |
?? ?? |
?? |
?? ? |
?? ?? |
P- ?? |
| H301 |
??? ??? |
?? ?? ?? - ?? |
?? 3 |
?? |
|
P264, P270, P301+P310, P321, P330,P405, P501 |
|
| ??????: |
| P264 |
?? ??? ?? ??? ????. |
| P264 |
?? ??? ?? ??? ????. |
| P270 |
? ??? ??? ??? ???, ???? ???? ???. |
| P321 |
(…) ??? ???. |
| P405 |
???? ?????. |
|
| NFPA 704 |
|
|
|
Ethyl cyanoglyoxylate-2-oxime C??? ??, ??, ??
??? ??
light yellow crystals or chunks
??
A non-explosive alternative to HOBt.
Ethyl cyanoglyoxylate-2-oxime ?? ?? ? ???
???
?? ??
Ethyl cyanoglyoxylate-2-oxime ?? ??
???( 360)?? ??
Ethyl cyanoglyoxylate-2-oxime ?? ??:
