2-(DiMethylaMino)acetaldehyde sulfite
|
|
2-(DiMethylaMino)acetaldehyde sulfite ??
- ?? ??
- under inert gas (nitrogen or Argon) at 2-8°C
- ??? ??
- ??
- ??? ??
- ??? ??
- ??
- ???
- InChI
- InChI=1S/C4H9NO.H2O3S/c1-5(2)3-4-6;1-4(2)3/h4H,3H2,1-2H3;(H2,1,2,3)
- InChIKey
- XALXJVVARIGVBA-UHFFFAOYSA-N
- SMILES
- C(=O)CN(C)C.S(O)(O)=O
??
- ?? ? ?? ??
- ?? ? ???? ?? (GHS)
| HS ?? | 2912190090 |
|---|
| ????(GHS): |
|
||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| ?? ?: | Warning | ||||||||||||||||||||||||||||||||||||||||||
| ??·?? ??: |
|
||||||||||||||||||||||||||||||||||||||||||
| ??????: |
|
2-(DiMethylaMino)acetaldehyde sulfite C??? ??, ??, ??
??
2-(Dimethylamino)acetaldehyde sulfite is an intermediate compound that can be used in the preparation of the hallucinogenic compounds psilocin and psilocybin.2-(DiMethylaMino)acetaldehyde sulfite ?? ?? ? ???
???
?? ??
2-(DiMethylaMino)acetaldehyde sulfite ?? ??
???( 31)?? ??
| ??? | ?? | ??? | ?? | ?? ? | ?? |
|---|---|---|---|---|---|
| Fuxin Pharmaceutical | +86-021-021-50872116 +8613122107989 |
contact@fuxinpharm.com | China | 10000 | 58 |
| HANGZHOU LEAP CHEM CO., LTD. | +86-571-87711850 |
market18@leapchem.com | China | 43333 | 58 |
| Aladdin Scientific | |
tp@aladdinsci.com | United States | 57505 | 58 |
| Amadis Chemical Company Limited | 571-89925085 |
sales@amadischem.com | China | 131956 | 58 |
| Shanghai Hanhong Scientific Co.,Ltd. | 021-54306202 13764082696 |
info@hanhongsci.com | China | 42934 | 64 |
| Tongchuang Pharma(Suzhou). Co., Ltd. | 0512-63263366 18912765016 |
tongtf110@sina.com | China | 998 | 62 |
| Cool Pharm, Ltd | 021-60455363 18019463053 |
sales@coolpharm.com | China | 8455 | 58 |
| Shanghai YuanYe Biotechnology Co., Ltd. | 021-61312847; 18021002903 |
3008007409@qq.com | China | 89686 | 60 |
| Aikon International Limited | 025-58859352 13913916777 |
dt3@aikonchem.com | China | 15491 | 58 |
| Rhawn Reagent | 400-400-1332688 18019345275 |
huyue@rhawn.cn | China | 14948 | 58 |