(2,4,6-trimethoxyphenyl)methanethiol
|
|
(2,4,6-trimethoxyphenyl)methanethiol ??? ???
|
|
|
- ?? ??:
- 212555-23-2
- ???:
- (2,4,6-trimethoxyphenyl)methanethiol
- ???(??):
- TmobSH;2,4,6-trimethoxybenzylthiol;Piperidine,1-(3-butyn-6-yl)-;2,4,6-trimethyloxybenzylthiol;2,4,6-Trimethoxybenzylmercaptan;Benzoicacid,4,5-dibromo-3-fluoro-;2,4,6-Trimethoxybenzenemethanethiol;(2,4,6-trimethoxyphenyl)methanethiol;Benzenemethanethiol, 2,4,6-trimethoxy-;3-Isoxazolecarboxylicacid,7-methyl-,hydrazide
- CBNumber:
- CB92485699
- ???:
- C10H14O3S
- ??? ??:
- 214.28
- MOL ??:
- 212555-23-2.mol
|
(2,4,6-trimethoxyphenyl)methanethiol ??
- ?? ?
- 326℃
- ??
- 1.117
- ???
- 151℃
- ?? ??
- Inert atmosphere,Room Temperature
- ?? ?? (pKa)
- 9.07±0.10(Predicted)
- ??
- White to off-white Solid
- InChI
- InChI=1S/C10H14O3S/c1-11-7-4-9(12-2)8(6-14)10(5-7)13-3/h4-5,14H,6H2,1-3H3
- InChIKey
- WBBBQLNBASXWLG-UHFFFAOYSA-N
- SMILES
- C1(CS)=C(OC)C=C(OC)C=C1OC
??
- ?? ? ?? ??
- ?? ? ???? ?? (GHS)
| ????(GHS): |
|
| ?? ?: |
Warning |
| ??·?? ??: |
| ?? |
??·?? ?? |
?? ?? |
?? |
?? ? |
?? ?? |
P- ?? |
| H302 |
??? ??? |
?? ?? ?? - ?? |
?? 4 |
?? |
|
P264, P270, P301+P312, P330, P501 |
| H315 |
??? ??? ??? |
????? ?? ????? |
?? 2 |
?? |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
?? ?? ??? ??? |
?? ? ?? ?? ??? ?? |
?? 2A |
?? |
|
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
?? ???? ??? ? ?? |
?? ???? ?? - 1? ??;???? ?? |
?? 3 |
?? |
|
|
|
| ??????: |
| P264 |
?? ??? ?? ??? ????. |
| P264 |
?? ??? ?? ??? ????. |
| P270 |
? ??? ??? ??? ???, ???? ???? ???. |
| P280 |
????/???/???/?????? ?????. |
| P301+P312 |
??? ???? ??? ????(??)? ??? ????. |
| P302+P352 |
??? ??? ??? ?? ????. |
| P305+P351+P338 |
?? ??? ? ?? ?? ???? ????. ???? ?????? ?????. ?? ????. |
| P321 |
(…) ??? ???. |
| P330 |
?? ?????. |
| P332+P313 |
?? ??? ??? ???? ??· ??? ????. |
| P362 |
??? ??? ?? ?? ?? ????? |
| P501 |
...? ??? / ??? ?? ???. |
|
(2,4,6-trimethoxyphenyl)methanethiol C??? ??, ??, ??
??
(2,4,6-Trimethoxyphenyl)methanethiol is a reactant used in the synthesis of thiolactone polymers that mimic natural nucleosides.
(2,4,6-trimethoxyphenyl)methanethiol ?? ?? ? ???
???
?? ??
(2,4,6-trimethoxyphenyl)methanethiol ?? ??
???( 48)?? ??
