|
|
| | 1H,1H,10H,10H-PERFLUORO-1,10-DECANEDIOL Basic information |
| Product Name: | 1H,1H,10H,10H-PERFLUORO-1,10-DECANEDIOL | | Synonyms: | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-HEXADECAFLUORO-1,10-DECANEDIOL;1:8:1 FTDIOH;1H,1H,10H,10H-PERFLUORO-1,10-DECANEDIOL;1H,1H,10H,10H-PERFLUORODECANE-1,10-DIOL;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-Hexadecafluoro-1,10-decanediol,96%;1H,1H,10H,10H-Perfluorodecane-1,10-diol ,96%;1H,1H,10H,10H-Perfluorodecane-1,10-diol 96%;1H,1H,10H,10H-Perfluoro-1,10-decanediol 96% | | CAS: | 754-96-1 | | MF: | C10H6F16O2 | | MW: | 462.13 | | EINECS: | | | Product Categories: | Organic Building Blocks;Oxygen Compounds;Polyols | | Mol File: | 754-96-1.mol |  |
| | 1H,1H,10H,10H-PERFLUORO-1,10-DECANEDIOL Chemical Properties |
| Melting point | 135-137 °C (lit.) | | Boiling point | 132 °C/4 mmHg (lit.) | | density | 1.6113 (estimate) | | Fp | 132°C/4mm | | form | powder to crystal | | pka | 12.59±0.10(Predicted) | | color | White to Almost white | | BRN | 1894671 | | InChI | 1S/C10H6F16O2/c11-3(12,1-27)5(15,16)7(19,20)9(23,24)10(25,26)8(21,22)6(17,18)4(13,14)2-28/h27-28H,1-2H2 | | InChIKey | NSKCTPBWPZPFHW-UHFFFAOYSA-N | | SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CO | | CAS DataBase Reference | 754-96-1(CAS DataBase Reference) | | EPA Substance Registry System | 1H,1H,10H,10H-Perfluorodecane-1,10-diol (754-96-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29055900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Carc. 2 Lact. Repr. 1B STOT RE 1 |
| | 1H,1H,10H,10H-PERFLUORO-1,10-DECANEDIOL Usage And Synthesis |
| Chemical Properties | white powder and chunks | | Uses | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-Hexadecafluoro-1,10-decanediol may be used in the preparation of diverse bromo(ester) (macro)initiators, required for the preparation of fluorinated pentablock as well as amphiphilic triblock copolymers with a central polyether segment. | | General Description | 2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-Hexadecafluoro-1,10-decanediol (1H,1H,10H,10H-Perfluorodecane-1,10-diol) is a highly fluorinated decanediol. The molecular orientation and multilayer formation of 1H,1H,10H,10H-perfluorodecane-1,10-diol (FC10diol) at the hexane/water interface has been investigated. The interfacial tension of the hexane solution of 1H,1H,10H,10H-perfluorodecane-1,10-diol (FC10diol) against water has been measured. Its freezing point and density have been determined. |
| | 1H,1H,10H,10H-PERFLUORO-1,10-DECANEDIOL Preparation Products And Raw materials |
|