|
|
| | Carbamic acid, [(1R,2S)-2-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Basic information |
| Product Name: | Carbamic acid, [(1R,2S)-2-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI) | | Synonyms: | Carbamic acid, [(1R,2S)-2-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI);(1R,2S)-2-Amino-1-(N-Boc-amino)cyclopentane;(1R,2S)-2-AMino-1-(Boc-aMino)cyclopentane;tert-butyl (1R,2S)-2-aMinocyclopentylcarbaMate;(1R)-cis-N-Boc-1,2-diaminocyclopentane;(1R,2S)-cis-N-Boc-1,2-cyclopentanediamine;(1S,2R)-2-(Boc-amino)cyclopentylamine;[(1R,2S)-2-aminocyclopentyl]Carbamic acid 1,1-dimethylethyl ester | | CAS: | 721395-15-9 | | MF: | C10H20N2O2 | | MW: | 200.28 | | EINECS: | | | Product Categories: | N-BOC;CYCLOPENTANE | | Mol File: | 721395-15-9.mol | ![Carbamic acid, [(1R,2S)-2-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Structure](CAS/GIF/721395-15-9.gif) |
| | Carbamic acid, [(1R,2S)-2-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Chemical Properties |
| Boiling point | 304.2±31.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 12.25±0.40(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-8-6-4-5-7(8)11/h7-8H,4-6,11H2,1-3H3,(H,12,13)/t7-,8+/m0/s1 | | InChIKey | PAXDIBGWURAVIH-JGVFFNPUSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CCC[C@@H]1N |
| Hazard Codes | Xi | | Risk Statements | 38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 |
| | Carbamic acid, [(1R,2S)-2-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Usage And Synthesis |
| | Carbamic acid, [(1R,2S)-2-aminocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Preparation Products And Raw materials |
|