- Pomolic acid
-
- $113.00
-
2026-05-26
- CAS:13849-91-7
- Purity: 99.79%
- Supply Ability: 10g
- Pomolic acid
-
- $9.80
-
2020-02-11
- CAS:13849-91-7
- Min. Order: 1g
- Purity: ＞98%
- Supply Ability: 20 tons
|
| | POMOLIC ACID Basic information |
| Product Name: | POMOLIC ACID | | Synonyms: | POMOLIC ACID;3β,19-Dihydroxy-5α-urs-12-en-28-oic acid;3β,19-Dihydroxyurs-12-en-28-oic acid;3β,19α-Dihydroxyurs-12-ene-28-oic acid;Urs-12-en-28-oic acid, 3,19-dihydroxy-, (3β)-;Randialic acid A;(1R,2R,4aS,6aS,6bR,8aR,10S,12aR,12bR,14bS)-1,10-Dihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-octadecahydropicene-4a(2H)-carboxylic acid;cancer,Inhibitor,inhibit,Randialic acid A,Pomolic acid,pentacyclic triterpene,ROS,Apoptosis,Prostate | | CAS: | 13849-91-7 | | MF: | C30H48O4 | | MW: | 472.7 | | EINECS: | | | Product Categories: | Triterpenoids;Miscellaneous Natural Products | | Mol File: | 13849-91-7.mol |  |
| | POMOLIC ACID Chemical Properties |
| Melting point | 297-299 °C(Solv: chloroform (67-66-3); methanol (67-56-1)) | | Boiling point | 586.2±50.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | 4°C, protect from light | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 4.48±0.70(Predicted) | | color | White to off-white | | biological source | plant | | Water Solubility | water: slightly soluble | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | ZZTYPLSBNNGEIS-OPAXANQDSA-N | | SMILES | O[C@]1([C@@H]2[C@@](CC[C@]3([C@]4([C@@H]([C@@]5([C@H](C([C@H](CC5)O)(C)C)CC4)C)CC=C32)C)C)(CC[C@H]1C)C(=O)O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | POMOLIC ACID Usage And Synthesis |
| Uses | Pomolic Acid is a pentacyclic triterpene isolated from Euscaphis japonica and an inhibitor of CXCR4. It exhibits anti-cancer and anti-viral properties against MCF7 human breast cancer cells and HIV, respectively. Pomolic Acid can be a promising therapeutic agent for the treatment of cancer metastasis. | | Definition | ChEBI: Pomolic acid is a triterpenoid. It has a role as a metabolite. | | Biological Activity | Pomolic acid is highly effective in inhibiting cell growth and inducing apoptosis. |
| | POMOLIC ACID Preparation Products And Raw materials |
|