2-Toluenesulfonyl isocyanate manufacturers
|
| | 2-Toluenesulfonyl isocyanate Basic information |
| | 2-Toluenesulfonyl isocyanate Chemical Properties |
| Boiling point | 129 °C (5 mmHg) | | density | 1.303 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.54(lit.) | | Fp | >230 °F | | storage temp. | 0-6°C | | solubility | reacts | | form | Oil | | color | Colourless | | Water Solubility | reacts | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C8H7NO3S/c1-7-4-2-3-5-8(7)13(11,12)9-6-10/h2-5H,1H3 | | InChIKey | HEBTZZBBPUFAFE-UHFFFAOYSA-N | | SMILES | C1(S(N=C=O)(=O)=O)=CC=CC=C1C | | CAS DataBase Reference | 32324-19-9(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 14-20/21/22-42-36/37/38 | | Safety Statements | 23-26-27-28-37/39-8-36/37/39 | | RIDADR | UN 2206 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1(a) | | PackingGroup | II | | HS Code | 2935909099 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral
Resp. Sens. 1 |
| | 2-Toluenesulfonyl isocyanate Usage And Synthesis |
| Chemical Properties | clear colourless to light yellow liquid | | Uses | 2-Methylbenzenesulfonyl Isocyanate is a reagent in the preparation of chiral hydropyrimidines. |
| | 2-Toluenesulfonyl isocyanate Preparation Products And Raw materials |
|