|
|
| | 2-(1H-indol-3-yl)acetaldehyde Basic information |
| Product Name: | 2-(1H-indol-3-yl)acetaldehyde | | Synonyms: | 2-(1H-indol-3-yl)acetaldehyde;1H-Indole-3-acetaldehyde(9CI);indol-3-ylacetaldehyde;(1H-Indol-3-yl)-acetaldehyde;INDOLE3-ACETALDEHYDE;INDOL-3-ACETALDEHYDE;Tryptophan Impurity 16;Tryptophan Impurity 1 (Indole 3-Acetaldehyde) | | CAS: | 2591-98-2 | | MF: | C10H9NO | | MW: | 159.18 | | EINECS: | | | Product Categories: | INDOLE | | Mol File: | 2591-98-2.mol |  |
| | 2-(1H-indol-3-yl)acetaldehyde Chemical Properties |
| Boiling point | 120 °C(Press: 10-15 Torr) | | density | 1.205±0.06 g/cm3(Predicted) | | storage temp. | -20 ℃ | | pka | 16.75±0.30(Predicted) | | InChI | InChI=1S/C10H9NO/c12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,6-7,11H,5H2 | | InChIKey | WHOOUMGHGSPMGR-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(CC=O)=C1 |
| | 2-(1H-indol-3-yl)acetaldehyde Usage And Synthesis |
| Description | 2-(1H-indol-3-yl)acetaldehyde is an indole acetaldehyde compound. It can be produced by substitution of the methyl hydrogen on the acetaldehyde by the indol-3-yl group. It is also an intermediate metabolite in the metabolism of tryptophan. | | Chemical Properties | Solid | | Uses | Tryptaldehyde is used as plasma metabolite biomarker related to secondary hyperparathyroidism and parathyroid hormone. | | Definition | ChEBI: An indoleacetaldehyde that is acetaldehyde in which one of the methyl hydrogens are replaced by a indol-3-yl group. It is an intermediate metabolite in the metabolism of tryptophan. |
| | 2-(1H-indol-3-yl)acetaldehyde Preparation Products And Raw materials |
|