2-Bromobutyryl bromide manufacturers
|
| | 2-Bromobutyryl bromide Basic information | | Uses |
| | 2-Bromobutyryl bromide Chemical Properties |
| Boiling point | 142-144 °C(lit.) | | density | 1.905 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.512(lit.) | | Fp | >230 °F | | storage temp. | Storage temp. -20°C | | form | clear liquid | | color | Colorless to Light orange to Yellow | | Specific Gravity | 1.905 | | InChI | InChI=1S/C4H6Br2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 | | InChIKey | HHKDBXNYWNUHPL-UHFFFAOYSA-N | | SMILES | C(Br)(=O)C(Br)CC | | CAS DataBase Reference | 26074-52-2(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-36/37 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 19-21 | | HS Code | 2915.90.5050 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| | 2-Bromobutyryl bromide Usage And Synthesis |
| Uses | 2-Bromobutyryl bromide can be used to prepare cyclohexane rings via cross-coupling reactions with organometallic compounds. | | Chemical Properties | Colorless or slightly yellow liquid |
| | 2-Bromobutyryl bromide Preparation Products And Raw materials |
|