PSEUDOIONONE manufacturers
- Pseudoionone
-
-
2026-05-29
- CAS:141-10-6
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 1000kg/month
- PSEUDOIONONE
-
- $5.00
-
2025-09-25
- CAS:141-10-6
- Min. Order: 1KG
- Purity: 98%
- PSEUDOIONONE
-
- $1.30
-
2024-10-22
- CAS:141-10-6
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 10kg
|
| Product Name: | PSEUDOIONONE | | Synonyms: | PSEUDOIONONE;PSI-IONONE;5,9-Undecatrien-2-one,6,10-dimethyl-3;2 6-DIMETHYLHENDECA-2 6 8-TRIEN-10-ONE;2,6-Dimethyl-2,6,8-undecatriene-10-one;Ai3-22131;Einecs 205-457-1;Pseudoionone technical, Mixture of isoMers, >=90% (GC) | | CAS: | 141-10-6 | | MF: | C13H20O | | MW: | 192.3 | | EINECS: | 205-457-1 | | Product Categories: | | | Mol File: | 141-10-6.mol |  |
| | PSEUDOIONONE Chemical Properties |
| Melting point | <25 °C | | Boiling point | 114-116 °C2 mm Hg(lit.) | | density | 0.90 g/mL at 20 °C(lit.) | | FEMA | 4299 | PSEUDOIONONE | | refractive index | n20/D 1.53 | | Fp | 84℃ | | form | liquid | | Odor | at 100.00 %. sweet waxy citrus floral balsamic dry dusty powdery spicy | | Odor Type | balsamic | | Water Solubility | 97mg/L at 25℃ | | JECFA Number | 2187 | | BRN | 1722925 | | InChI | 1S/C13H20O/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h6-7,9-10H,5,8H2,1-4H3/b10-6+,12-9+ | | InChIKey | JXJIQCXXJGRKRJ-KOOBJXAQSA-N | | SMILES | C\C(C)=C/CC\C(C)=C\C=C\C(C)=O | | LogP | 3.69 | | CAS DataBase Reference | 141-10-6 | | EPA Substance Registry System | Pseudoionone (141-10-6) |
| Safety Statements | 23-24/25 | | WGK Germany | 2 | | RTECS | YQ2833700 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Toxicity | rabbit,LDLo,skin,5gm/kg (5000mg/kg),Food and Chemical Toxicology. Vol. 26, Pg. 311, 1988. |
| | PSEUDOIONONE Usage And Synthesis |
| Preparation | Pseudo-ionone can be prepared from citric acid and acetone. The product with lower purity can be obtained by treating with lemongrass and acetone, bleaching powder, cobalt nitrate and ethanol. | | Chemical Properties | Pale-yellow liquid.Soluble in alcohol and
ether. Combustible. | | Chemical Properties | Yellow.to.dark.clear.oily.liquid;.sweet,waxy,citrus,floral,balsamic,.dry,dusty,powdery,spicy.aroma. | | Occurrence | Not.reported.found.in.nature. | | Uses | Perfumery, cosmetics. | | Definition | ChEBI: A terpene ketone derived from ring cleavage of the apo carotenoid beta-ionone. | | Aroma threshold values | Medium.strength.odor,.balsamic.type. |
| | PSEUDOIONONE Preparation Products And Raw materials |
|