- Bisbentiamine
-
- $1.00
-
2019-07-06
- CAS:2667-89-2
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100kg
|
| | Bisbentiamine Basic information |
| Product Name: | Bisbentiamine | | Synonyms: | dibenzoate(ester);formamide,n,n’-(dithiobis(2-(2-hydroxyethyl)-1-methylvinylene))bis(n-((4-amino;BISBENTIAMINE DISULFIDE;BENZOYLTHIAMINEDISULPHIDE;N,N'-(Dithiobis(2-(2-hydroxyethyl)-1-methylvinylene))bis(N-((4-amino-2-methyl-5-pyrimidinyl)methyl)formamide) dibenzoate;Bisbentiamin;BISBENTIAMINE;benzoylthiaminedisulfide | | CAS: | 2667-89-2 | | MF: | C38H42N8O6S2 | | MW: | 770.92 | | EINECS: | 220-206-6 | | Product Categories: | | | Mol File: | 2667-89-2.mol |  |
| | Bisbentiamine Chemical Properties |
| Melting point | 140-145 °C | | Boiling point | 987.4±65.0 °C(Predicted) | | density | 1.38 g/cm3 | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO, Methanol (Slightly) | | form | Solid | | pka | 5.82±0.10(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChIKey | IWXAZSAGYJHXPX-OEDDBACWSA-N | | SMILES | C(N(CC1=CN=C(C)N=C1N)/C(/C)=C(\SS/C(/CCOC(=O)C1=CC=CC=C1)=C(/N(CC1=CN=C(C)N=C1N)C=O)\C)/CCOC(=O)C1=CC=CC=C1)=O | | CAS DataBase Reference | 2667-89-2 |
| | Bisbentiamine Usage And Synthesis |
| Uses | Bisbentiamine (CAS# 2667-89-2) is a derivative of vitamin B1, and has shown to react with sarcoplasmic proteins in vivo. | | Definition | ChEBI: Bisbentiamine is an organic molecular entity. |
| | Bisbentiamine Preparation Products And Raw materials |
|