| Company Name: |
BioBioPha Co., Ltd.
|
| Tel: |
0871-65217109 13211707573; |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:O-Geranylconiferyl alcohol
CAS:129350-09-0
Purity:>97.0% Package:5mg Remarks:BBP02541
|
| Company Name: |
Sichuan Wei Keqi Biological Technology Co., Ltd.
|
| Tel: |
028-81700200 18116577057 |
| Email: |
3003855609@qq.com |
| Products Intro: |
Product Name:O-Geranylconiferylalcohol
CAS:129350-09-0
Purity:98% Package:5mg；10mg；20mg；50mg；100mg；200mg；500mg；1g
|
|
| | O-geranylconiferyl alcohol Basic information |
| Product Name: | O-geranylconiferyl alcohol | | Synonyms: | O-geranylconiferyl alcohol;(2E)-3-[4-[[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]oxy]-3-methoxyphenyl]-2-propen-1-ol;3-(4-((3,7-DiMethylocta-2,6-dien-1-yl)oxy)-3-Methoxyphenyl)prop-2-en-1-ol;2-Propen-1-ol, 3-[4-[[(2E)-3,7-dimethyl-2,6-octadien-1-yl]oxy]-3-methoxyphenyl]-, (2E)-;Conifegrol >=95% (LC/MS-ELSD);3-[4-(3,7-dimethylocta-2,6-dienoxy)-3-methoxyphenyl]prop-2-en-1-ol;(E)-3-(4-(((E)-3,7-dimethylocta-2,6-dien-1-yl)oxy)-3-methoxyphenyl)prop-2-en-1-ol;Conifegrol | | CAS: | 129350-09-0 | | MF: | C20H28O3 | | MW: | 316.44 | | EINECS: | | | Product Categories: | | | Mol File: | 129350-09-0.mol |  |
| | O-geranylconiferyl alcohol Chemical Properties |
| Boiling point | 469.887±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.016±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | form | solid | | pka | 14.111±0.10(predicted) | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C20H28O3/c1-16(2)7-5-8-17(3)12-14-23-19-11-10-18(9-6-13-21)15-20(19)22-4/h6-7,9-12,15,21H,5,8,13-14H2,1-4H3/b9-6+,17-12+ | | InChIKey | UJQXYSRVSXKEES-YIERNNEGSA-N | | SMILES | COc1cc(\C=C\CO)ccc1OC\C=C(/C)CC\C=C(/C)C | | LogP | 4.642 (est) |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | O-geranylconiferyl alcohol Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products |
| | O-geranylconiferyl alcohol Preparation Products And Raw materials |
|