| Company Name: |
Nanjing Shizhou Biology Technology Co.,Ltd Gold
|
| Tel: |
025-85560043 13675144456 |
| Email: |
sean.lv@synzest.com |
| Products Intro: |
Product Name:citreoviridin CAS:25425-12-1 Purity:95%HPLC Package:500mg;1g;5g;10g
|
|
| | citreoviridin Basic information |
| Product Name: | citreoviridin | | Synonyms: | citreoviridin;CITREOVIRIDINE;4-Methoxy-5-methyl-6-[(1E,3E,5E,7E)-7-methyl-8-[(2S)-tetrahydro-3α,4β-dihydroxy-2,4,5β-trimethylfuran-2-yl]-1,3,5,7-octatetrenyl]-2H-pyran-2-one;4-Methoxy-5-methyl-6-[(1E,3E,5E,7E)-7-methyl-8-[(2S)-tetrahydro-3α,4β-dihydroxy-2,4,5β-trimethylfuran-2β-yl]-1,3,5,7-octatetrenyl]-2H-pyran-2-one;4-Methoxy-5-methyl-6-[(1E,3E,5E,7E)-7-methyl-8-[(2S)-tetrahydro-3α,4β-dihydroxy-2α,4,5β-trimethylfuran-2-yl]-1,3,5,7-octatetrenyl]-2H-pyran-2-one;Citreoviridin, froM PenicilliuM citreoviride biourge;Citreoviridine A;6-[(1E,3E,5E,7E)-8-[(2R,3R,4R,5R)-3,4-dihydroxy-2,4,5-trimethyloxolan-2-yl]-7-methylocta-1,3,5,7-tetraenyl]-4-methoxy-5-methylpyran-2-one | | CAS: | 25425-12-1 | | MF: | C23H30O6 | | MW: | 402.48 | | EINECS: | | | Product Categories: | mycotoxin | | Mol File: | 25425-12-1.mol |  |
| | citreoviridin Chemical Properties |
| Melting point | 107-111℃ | | Boiling point | 444.62°C (rough estimate) | | density | 1.1271 (rough estimate) | | refractive index | 1.4593 (estimate) | | storage temp. | 2-8°C | | solubility | DMSO: 10 mg/ml; Ethanol: 10 mg/ml | | form | Yellow to orange powder. | | pka | 13.67±0.70(Predicted) | | color | Light yellow to yellow | | Stability: | Light Sensitive | | InChI | InChI=1S/C23H30O6/c1-15(14-22(4)21(25)23(5,26)17(3)29-22)11-9-7-8-10-12-18-16(2)19(27-6)13-20(24)28-18/h7-14,17,21,25-26H,1-6H3/b8-7+,11-9+,12-10+,15-14+ | | InChIKey | JLSVDPQAIKFBTO-USJRQALFSA-N | | SMILES | C1(C)(/C=C(\C)/C=C/C=C/C=C/C2OC(C=C(OC)C=2C)=O)OC(C)C(O)(C)C1O |
| | citreoviridin Usage And Synthesis |
| Chemical Properties | Yellow powder | | Uses | Citreoviridin is a mycotoxin isolated from several Penicillium species that has been shown to inhibit the mitochondrial ATP synthetase system. It inhibits soluble ATPase (KD = 4.1 μM), ADP-stimulated respiration in isolated rat liver mitochondria (KD = 0.15 μM), and ATP-driven reduction of NAD+ by succinate (KD = 2 μM). Citreoviridin has been used to target ectopic ATPase activity in cancer cells in order to modulate the metabolic activity associated with tumorigenesis.[Cayman Chemical] | | Uses | Citreoviridin is the dominant analogue of a family of tetraene mycotoxins with potent neurotoxic effects, produced by several species of Aspergillus and Penicillium. Citreoviridin inhibits mitochondrial ATPase and is a causative agent of cardiac beriberi. | | Definition | ChEBI: Citreoviridin is a member of 2-pyranones. |
| | citreoviridin Preparation Products And Raw materials |
|