- Okanin
-
- $80.00
-
2026-05-11
- CAS:484-76-4
- Purity: 99.95%
- Supply Ability: 10g
|
| Product Name: | OKANIN | | Synonyms: | OKANIN;2',3',4',3,4,-PENTAHYDROXYCHALCONE;(E)-3-(3,4-Dihydroxyphenyl)-1-(2,3,4-trihydroxyphenyl)-2-propen-1-one;2',3,3',4,4'-Pentahydroxychalcone;(E)-3-(3,4-dihydroxyphenyl)-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one;2-Propen-1-one, 3-(3,4-dihydroxyphenyl)-1-(2,3,4-trihydroxyphenyl)-, (2E)-;Toll-like Receptor (TLR),Nuclear factor-κB,NF-κB,Inhibitor,Nuclear factor-kappaB,Okanin,inhibit;Okanen | | CAS: | 484-76-4 | | MF: | C15H12O6 | | MW: | 288.25 | | EINECS: | | | Product Categories: | | | Mol File: | 484-76-4.mol |  |
| | OKANIN Chemical Properties |
| Melting point | 235-242 °C | | Boiling point | 638.0±55.0 °C(Predicted) | | density | 1.584±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 7.22±0.40(Predicted) | | color | Dark Orange | | Stability: | Very Hygroscopic | | InChI | InChI=1S/C15H12O6/c16-10(9-3-6-12(18)15(21)14(9)20)4-1-8-2-5-11(17)13(19)7-8/h1-7,17-21H/b4-1+ | | InChIKey | GSBNFGRTUCCBTK-DAFODLJHSA-N | | SMILES | C(C1=CC=C(O)C(O)=C1O)(=O)/C=C/C1=CC=C(O)C(O)=C1 |
| | OKANIN Usage And Synthesis |
| Uses | Okanin, extracted from Dalbergia sissoo Roxb. leaves is a good antibacterial agent and possible anti-inflammatory agent. Chalcone. Anti-cancer agent. | | Definition | ChEBI: A member of the class of chalcones that is trans-chalcone substituted by hydroxy groups at positions 3, 4, 2', 3', and 4' respectively. | | IC 50 | TLR4; p65 |
| | OKANIN Preparation Products And Raw materials |
|