DL-Aspartic acid potassium salt manufacturers
|
| | DL-Aspartic acid potassium salt Basic information |
| | DL-Aspartic acid potassium salt Chemical Properties |
| solubility | H2O: soluble | | form | powder | | color | white | | Water Solubility | H2O: soluble | | Major Application | cell analysis
peptide synthesis | | InChI | 1S/C4H7NO4.K/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H,6,7)(H,8,9);/q;+1/p-1 | | InChIKey | TXXVQZSTAVIHFD-UHFFFAOYSA-M | | SMILES | [K+].NC(CC(O)=O)C([O-])=O |
| WGK Germany | 3 | | F | 3 | | Storage Class | 13 - Non Combustible Solids |
| | DL-Aspartic acid potassium salt Usage And Synthesis |
| Uses | cell analysis
peptide synthesis | | Biochem/physiol Actions | DL-Aspartic acid (DL-Asp) is a racemic mixture of the proteinogenic amino acid L-aspartate and the non-proteinogenic amino acid D-aspartate. DL-Aspartic acid is used in studies on factors and conditions that enhance semen and sperm quality. DL-Aspartic acid is used to develop and assess amino acid racemic resolution and racemic interconversion technologies. Principal neurotransmitter for fast synaptic excitation. |
| | DL-Aspartic acid potassium salt Preparation Products And Raw materials |
|