|
|
| | 4-Propyl-4'-cyanobiphenyl Basic information |
| Product Name: | 4-Propyl-4'-cyanobiphenyl | | Synonyms: | 4'-N-PROPYLBIPHENYL-4-CARBONITRILE;4-CYANO-4'-PROPYLBIPHENYL;[4-(4'-N-PROPYLPHENYL)BENZONITRILE];[1,1'-Biphenyl]-4-carbonitrile, 4'-propyl-;1’-biphenyl]-4-carbonitrile,4’-propyl-[;1’-Biphenyl]-4-carbonitrile,4’-propyl-[1;4’-propyl-biphenyl-4-carbonitrile;4’-propylbiphenyl-d-carbonitrile | | CAS: | 58743-76-3 | | MF: | C16H15N | | MW: | 221.3 | | EINECS: | 261-415-2 | | Product Categories: | Biphenyl & Diphenyl ether | | Mol File: | 58743-76-3.mol |  |
| | 4-Propyl-4'-cyanobiphenyl Chemical Properties |
| Melting point | 64-66°C | | Boiling point | 165-170 °C(Press: 2 Torr) | | density | 1.05±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C16H15N/c1-2-3-13-4-8-15(9-5-13)16-10-6-14(12-17)7-11-16/h4-11H,2-3H2,1H3 | | InChIKey | XFMPTZWVMVMELB-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(CCC)C=C2)=CC=C(C#N)C=C1 | | CAS DataBase Reference | 58743-76-3(CAS DataBase Reference) | | NIST Chemistry Reference | | | EPA Substance Registry System | |
| Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 3276 | | TSCA | TSCA listed | | HS Code | 2926.90.4801 | | HazardClass | 6.1 | | PackingGroup | III |
| Provider | Language |
|
ALFA
| English |
| | 4-Propyl-4'-cyanobiphenyl Usage And Synthesis |
| Chemical Properties | White crystal | | Uses | Intermediates of Liquid Crystals |
| | 4-Propyl-4'-cyanobiphenyl Preparation Products And Raw materials |
|