| Company Name: |
AN PharmaTech Co Ltd
|
| Tel: |
86(21)68097365 |
| Email: |
sales@anpharma.net |
| Products Intro: |
CAS:963-96-2
|
| Company Name: |
Henan Lien Chemical Products Co., Ltd.
|
| Tel: |
0371-63357898 15378766539 |
| Email: |
535046669@qq.com |
| Products Intro: |
Product Name:2,6-Dimethoxy-9,10-anthracenedione
CAS:963-96-2
Purity:98% Package:1g，5g，10g，25g，50g，100g
|
| Company Name: |
Zhengzhou Alpha Chemical Co. LTD
|
| Tel: |
0371-53732842 13383863444 |
| Email: |
3838551451@qq.com |
| Products Intro: |
Product Name:2,6-Dimethoxy-9,10-anthraquinone
CAS:963-96-2
Purity:98% Package:1g；5g；10g；25g；50g；100g；250g；500g；1kg;5kg
|
| Company Name: |
Sichuan BoYou Biotechnology Co., Ltd.
|
| Tel: |
028-65791793 18140026355 |
| Email: |
568470422@qq.com |
| Products Intro: |
Product Name:2,6-Dimethoxy-9,10-anthracenedione
CAS:963-96-2
Purity:95 Package:10g;100g;1kg;5kg
|
|
| | 2,6-Dimethoxy-9,10-anthraquinone Basic information |
| Product Name: | 2,6-Dimethoxy-9,10-anthraquinone | | Synonyms: | 2,6-Dimethoxy-9,10-anthraquinone;2,6-Dimethoxyanthraquinone;9,10-Anthracenedione, 2,6-dimethoxy-;2,6-dimethoxy-9,10-anthracenedione | | CAS: | 963-96-2 | | MF: | C16H12O4 | | MW: | 268.26 | | EINECS: | | | Product Categories: | | | Mol File: | 963-96-2.mol |  |
| | 2,6-Dimethoxy-9,10-anthraquinone Chemical Properties |
| InChI | InChI=1S/C16H12O4/c1-19-9-3-5-11-13(7-9)15(17)12-6-4-10(20-2)8-14(12)16(11)18/h3-8H,1-2H3 | | InChIKey | VZXGMACDZPAQOP-UHFFFAOYSA-N | | SMILES | C1=C2C(C(=O)C3=C(C2=O)C=CC(OC)=C3)=CC=C1OC |
| | 2,6-Dimethoxy-9,10-anthraquinone Usage And Synthesis |
| | 2,6-Dimethoxy-9,10-anthraquinone Preparation Products And Raw materials |
|