- Linderalactone
-
-
2023-02-24
- CAS:728-61-0
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | (R,10E)-4,8,9,12-Tetrahydro-3,11-dimethyl-6H-4,7-methenofuro[3,2-c]oxacycloundecin-6-one Basic information |
| Product Name: | (R,10E)-4,8,9,12-Tetrahydro-3,11-dimethyl-6H-4,7-methenofuro[3,2-c]oxacycloundecin-6-one | | Synonyms: | (4R,10E)-3,11-Dimethyl-4,8,9,12-tetrahydro-6H-4,7-methenofuro[3,2-c]oxacycloundecin-6-one;(R,10E)-4,8,9,12-Tetrahydro-3,11-dimethyl-6H-4,7-methenofuro[3,2-c]oxacycloundecin-6-one;(R,E)-3,11-DiMethyl-8,9-dihydro-4H-4,7-(Metheno)furo[3,2-c][1]oxacycloundecin-6(12H)-one;6H-4,7-Methenofuro[3,2-c]oxacycloundecin-6-one, 4,8,9,12-tetrahydro-3,11-dimethyl-, (4R,10E)-;Linderalactone-RM;Linderalactone, 10 mM in DMSO;Linderalactone/728-61-0;Linderalactone | | CAS: | 728-61-0 | | MF: | C15H16O3 | | MW: | 244.29 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 728-61-0.mol | ![(R,10E)-4,8,9,12-Tetrahydro-3,11-dimethyl-6H-4,7-methenofuro[3,2-c]oxacycloundecin-6-one Structure](CAS/GIF/728-61-0.gif) |
| | (R,10E)-4,8,9,12-Tetrahydro-3,11-dimethyl-6H-4,7-methenofuro[3,2-c]oxacycloundecin-6-one Chemical Properties |
| Melting point | 136-138 °C | | Boiling point | 437.9±45.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | -20°C, protect from light | | solubility | DMSO : 50 mg/mL (204.67 mM; Need ultrasonic) | | form | powder | | color | Beige | | Major Application | food and beverages | | InChI | 1S/C15H16O3/c1-9-4-3-5-11-7-13(18-15(11)16)14-10(2)8-17-12(14)6-9/h4,7-8,13H,3,5-6H2,1-2H3/b9-4+/t13-/m1/s1 | | InChIKey | LWCKQMHMTSRRAA-QGQQYVBWSA-N | | SMILES | [o]1c2c(c(c1)C)[C@@H]3OC(=O)C(=C3)CC\C=C(\C2)/C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (R,10E)-4,8,9,12-Tetrahydro-3,11-dimethyl-6H-4,7-methenofuro[3,2-c]oxacycloundecin-6-one Usage And Synthesis |
| Chemical Properties | Derived from the dried tuber of Linderae odorifera of the Lauraceae family | | Uses | food and beverages | | Definition | ChEBI: A natural product found in Neolitsea daibuensis. |
| | (R,10E)-4,8,9,12-Tetrahydro-3,11-dimethyl-6H-4,7-methenofuro[3,2-c]oxacycloundecin-6-one Preparation Products And Raw materials |
|