|
|
| | Tert-butyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate Basic information |
| Product Name: | Tert-butyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate | | Synonyms: | Racemic 2,5-diaza-bicyclo[2.2.2]octane-2-carboxylic acid tert-butyl ester;2,5-Diaza-bicyclo[2.2.2]octane-2-carboxylic acid tert-butyl este;2,5-DIAZA-BICYCLO[2.2.2]OCTANE-2-CARBOXYLIC ACID TERT-BUTYL ESTER;2-BOC-2,5-DIAZABICYCLO(2.2.2)OCTANE;5-Phenyl-2,5-diaza-bicyclo[2.2.2]octane-2-carboxylic acid tert-butyl ester;2,5-Diazabicyclo[2.2.2]octane-2-carboxylic acid, 1,1-diMethylethyl ester;1,1-dimethylethyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate;2,5-Diazabicyclo[2.2.2]octane-2-carboxylic acid, 1,1-dimethy... | | CAS: | 858671-91-7 | | MF: | C11H20N2O2 | | MW: | 212.29 | | EINECS: | | | Product Categories: | | | Mol File: | 858671-91-7.mol | ![Tert-butyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate Structure](CAS/GIF/858671-91-7.gif) |
| | Tert-butyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate Chemical Properties |
| Boiling point | 295.4±15.0 °C(Predicted) | | density | 1.076±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 9.72±0.20(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C11H20N2O2/c1-11(2,3)15-10(14)13-7-8-4-5-9(13)6-12-8/h8-9,12H,4-7H2,1-3H3 | | InChIKey | RBLOMFQUEUBEBG-UHFFFAOYSA-N | | SMILES | C12CCC(NC1)CN2C(OC(C)(C)C)=O |
| | Tert-butyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate Usage And Synthesis |
| Uses | Tert-butyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate can be used as a reagent for organic synthesis or as a pharmaceutical intermediate in the preparation of active biomolecular inhibitors. | | Synthesis | The general procedure for the synthesis of tert-butyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate from di-tert-butyl dicarbonate (6.5 mmol) and 2,5-diazabicyclo[2.2.2]octane dihydrochloride (7.06 mmol) is as follows: a solution of isopropanol (15 mL) of di-tert-butyl dicarbonate is slowly added dropwise to a solution of isopropanol (100 mL), water (35 mL), and 1M sodium hydroxide solution (6.5 mL) at 0°C, containing 2,5-diazabicyclo[2.2.2]octane dihydrochloride. bicyclo[2.2.2]octane dihydrochloride in a mixture of isopropanol (100 mL), water (35 mL) and 1M sodium hydroxide solution (6.5 mL). The reaction mixture was stirred at 0°C for 1.5 h and then concentrated to about 50 mL. Subsequently, the aqueous phase was saturated with solid sodium chloride and the pH was adjusted to 10 with 2 M sodium hydroxide solution. the aqueous phase was extracted with ethyl acetate (3 x 35 mL) and the combined organic layers were washed with brine and dried with magnesium sulfate. Finally, the solvent was removed by distillation under reduced pressure to afford the crude product tert-butyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate in 42% yield as a light yellow oil. | | References | [1] Patent: WO2005/63767, 2005, A2. Location in patent: Page/Page column 52 |
| | Tert-butyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate Preparation Products And Raw materials |
|