- 2,3-DIBROMOPYRAZINE
-
- $1.00
-
2019-07-06
- CAS:95538-03-7
- Min. Order: 1KG
- Purity: 95%
- Supply Ability: 500kg
|
| | 2,3-DIBROMOPYRAZINE Basic information |
| | 2,3-DIBROMOPYRAZINE Chemical Properties |
| Melting point | 59-61 °C | | Boiling point | 242.6±35.0 °C(Predicted) | | density | 2+-.0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -4.28±0.10(Predicted) | | form | solid | | color | Brown | | InChI | InChI=1S/C4H2Br2N2/c5-3-4(6)8-2-1-7-3/h1-2H | | InChIKey | VLPBEKHOQWMYTR-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=CN=C1Br |
| | 2,3-DIBROMOPYRAZINE Usage And Synthesis |
| | 2,3-DIBROMOPYRAZINE Preparation Products And Raw materials |
|