| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:4,4,5,5-Tetramethyl-2-(4-Phenylethynyl-Phenyl)-[1,3,2]Dioxaborolane CAS:1190376-20-5 Purity:98% Package:100mg;250mg;1g;5g;25g
|
|
| | 4,4,5,5-Tetramethyl-2-(4-phenylethynyl)[1,3,2]dioxaborolane Basic information |
| Product Name: | 4,4,5,5-Tetramethyl-2-(4-phenylethynyl)[1,3,2]dioxaborolane | | Synonyms: | 4,4,5,5-Tetramethyl-2-(4-phenylethynyl)[1,3,2]dioxaborolane;4,4,5,5-Tetramethyl-2-(4-phenylethynyl-phenyl)-[1,3,2]dioxaborolane;4,4,5,5-tetramethyl-2-[4-(2-phenylethynyl)phenyl]-1,3,2-dioxaborolane;4-[(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynylbenzene;1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-(2-phenylethynyl)phenyl]-;4-(Phenylethynyl)benzeneboronicacidpinacolester,97% | | CAS: | 1190376-20-5 | | MF: | C20H21BO2 | | MW: | 304.19 | | EINECS: | | | Product Categories: | | | Mol File: | 1190376-20-5.mol | ![4,4,5,5-Tetramethyl-2-(4-phenylethynyl)[1,3,2]dioxaborolane Structure](CAS/GIF/1190376-20-5.gif) |
| | 4,4,5,5-Tetramethyl-2-(4-phenylethynyl)[1,3,2]dioxaborolane Chemical Properties |
| Melting point | 96-100°C | | Boiling point | 428.7±28.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | solid | | Appearance | Light yellow to yellow Powder | | InChI | 1S/C20H21BO2/c1-19(2)20(3,4)23-21(22-19)18-14-12-17(13-15-18)11-10-16-8-6-5-7-9-16/h5-9,12-15H,1-4H3 | | InChIKey | AAIDERXZGJSORP-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2ccc(cc2)C#Cc3ccccc3 | | CAS DataBase Reference | 1190376-20-5 |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 4,4,5,5-Tetramethyl-2-(4-phenylethynyl)[1,3,2]dioxaborolane Usage And Synthesis |
| | 4,4,5,5-Tetramethyl-2-(4-phenylethynyl)[1,3,2]dioxaborolane Preparation Products And Raw materials |
|