|
|
| | AC-LEU-PNA Basic information |
| Product Name: | AC-LEU-PNA | | Synonyms: | N-ACETYL-L-LEUCINE P-NITROANILIDE;N-ALPHA-ACETYL-L-LEUCINE-P-NITROANILIDE;AC-LEU-PNA;AC-LEUCINE-PNA;ACETYL-L-LEUCINE 4-NITROANILIDE;N-Acetyl-L-Leucine-Para-Nitroanilide;Pentanamide, 2-(acetylamino)-4-methyl-N-(4-nitrophenyl)-, (2S)-;(2S)-2-acetamido-4-methyl-N-(4-nitrophenyl)pentanamide | | CAS: | 19746-40-8 | | MF: | C14H19N3O4 | | MW: | 293.32 | | EINECS: | | | Product Categories: | A - H;Amino Acids;Modified Amino Acids | | Mol File: | 19746-40-8.mol |  |
| | AC-LEU-PNA Chemical Properties |
| Boiling point | 567.2±35.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | −20°C | | pka | 12.52±0.70(Predicted) | | InChI | InChI=1S/C14H19N3O4/c1-9(2)8-13(15-10(3)18)14(19)16-11-4-6-12(7-5-11)17(20)21/h4-7,9,13H,8H2,1-3H3,(H,15,18)(H,16,19)/t13-/m0/s1 | | InChIKey | SLJKQHDBYBGOMH-ZDUSSCGKSA-N | | SMILES | C(NC1=CC=C([N+]([O-])=O)C=C1)(=O)[C@@H](NC(C)=O)CC(C)C |
| | AC-LEU-PNA Usage And Synthesis |
| Chemical Properties |
AC-LEU-PNA is a Solid.
| | Uses |
AC-LEU-PNA can be used in pharmaceutical synthesis and experimental research.
|
| | AC-LEU-PNA Preparation Products And Raw materials |
|