|
|
| | 2-Chloro-5-(trifluoroMethyl)pyrazine Basic information |
| | 2-Chloro-5-(trifluoroMethyl)pyrazine Chemical Properties |
| Boiling point | 85℃/112mm | | density | 1.478g/mLat 25℃ | | refractive index | n20/D 1.448 | | Fp | 66°C | | storage temp. | Store at room temperature | | form | liquid | | pka | -4.55±0.10(Predicted) | | color | Clear, colourless | | InChI | InChI=1S/C5H2ClF3N2/c6-4-2-10-3(1-11-4)5(7,8)9/h1-2H | | InChIKey | AIEGIFIEQXZBCP-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(C(F)(F)F)N=C1 | | CAS DataBase Reference | 799557-87-2 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2810 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | 8 | | HazardClass | CORROSIVE | | HS Code | 2933998090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-Chloro-5-(trifluoroMethyl)pyrazine Usage And Synthesis |
| Uses | 2-Chloro-5-(trifluoromethyl)pyrazine is used in preparation of N-hydroxypyridine-2-carboxamide, N-hydroxypyridazine-3-carboxamide, and N-hydroxypyrimidine-2-carboxamide derivatives as dihydroceramide desaturase-1 inhibitors. |
| | 2-Chloro-5-(trifluoroMethyl)pyrazine Preparation Products And Raw materials |
|