| Company Name: |
TLC Pharmaceutical Standards Ltd.
|
| Tel: |
18012923235 18012923235 |
| Email: |
chinasales04@tlcstandards.com.cn |
| Products Intro: |
Product Name:Carisoprodol-d7
CAS:1218911-16-0
Purity:95%+ HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Carisoprodol-D7 solution
CAS:1218911-16-0
|
| Company Name: |
Henan Kaixin Biomedical Co., Ltd.
|
| Tel: |
18135767668 18135767668 |
| Email: |
1101014211@qq.com |
| Products Intro: |
Product Name:Carisoprodol-D7
CAS:1218911-16-0
Purity:99% HPLC Package:25KG;1000KG
|
| Company Name: |
SynZeal Research Pvt Ltd
|
| Tel: |
+1 226-802-2078 |
| Email: |
standards@synzeal.com |
| Products Intro: |
Product Name:Carisoprodol D7
CAS:1218911-16-0
|
|
| | Carisoprodol-D7 Basic information |
| Product Name: | Carisoprodol-D7 | | Synonyms: | Carisoprodol-D7 solution;Carisoprodol-D7;Carisoprodol-D7 solution;Carisoprodol-D7, 0.1mg/ml in Methanol;Carisoprodol-D7, 1mg/ml in Methanol | | CAS: | 1218911-16-0 | | MF: | C12H17D7N2O4 | | MW: | 267.373092446 | | EINECS: | 200-659-6 | | Product Categories: | | | Mol File: | 1218911-16-0.mol |  |
| | Carisoprodol-D7 Chemical Properties |
| Fp | 9℃ | | storage temp. | -20°C | | form | liquid | | Major Application | clinical testing | | InChI | 1S/C12H24N2O4/c1-5-6-12(4,7-17-10(13)15)8-18-11(16)14-9(2)3/h9H,5-8H2,1-4H3,(H2,13,15)(H,14,16)/i4D3,7D2,8D2 | | InChIKey | OFZCIYFFPZCNJE-GDXCJPCVSA-N | | SMILES | [2H]C([2H])([2H])C(CCC)(C([2H])([2H])OC(N)=O)C([2H])([2H])OC(=O)NC(C)C |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | Carisoprodol-D7 Usage And Synthesis |
| Uses | Carisoprodol-d7 is the labeled analogue of Carisoprodol (C183580), a muscle relaxant (skeletal). |
| | Carisoprodol-D7 Preparation Products And Raw materials |
|