|
|
| | tert-butyl 7-hydroxy-2-azaspiro[3.5]nonane-2-carboxylate Basic information |
| Product Name: | tert-butyl 7-hydroxy-2-azaspiro[3.5]nonane-2-carboxylate | | Synonyms: | tert-butyl 7-hydroxy-2-azaspiro[3.5]nonane-2-carboxylate;2-Azaspiro[3.5]nonane-2-carboxylic acid, 7-hydroxy-, 1,1-diMethylethyl ester;7-Hydroxy-2-azaspiro[3.5]nonane-2-carboxylic acid 1,1-dimethylethyl ester;2-Boc-7-hydroxy-2-azaspiro[3.5]nonane - B7199;1,1-Dimethylethyl 7-hydroxy-2-azaspiro[3.5]nonane-2-carboxylate | | CAS: | 1363383-18-9 | | MF: | C13H23NO3 | | MW: | 241.33 | | EINECS: | | | Product Categories: | | | Mol File: | 1363383-18-9.mol | ![tert-butyl 7-hydroxy-2-azaspiro[3.5]nonane-2-carboxylate Structure](CAS/GIF/1363383-18-9.gif) |
| | tert-butyl 7-hydroxy-2-azaspiro[3.5]nonane-2-carboxylate Chemical Properties |
| Boiling point | 350.7±42.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 15.07±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H23NO3/c1-12(2,3)17-11(16)14-8-13(9-14)6-4-10(15)5-7-13/h10,15H,4-9H2,1-3H3 | | InChIKey | NQHGYUZNWXIZID-UHFFFAOYSA-N | | SMILES | C1C2(CCC(O)CC2)CN1C(OC(C)(C)C)=O | | CAS DataBase Reference | 1363383-18-9 |
| | tert-butyl 7-hydroxy-2-azaspiro[3.5]nonane-2-carboxylate Usage And Synthesis |
| Uses | tert-Butyl 7-Hydroxy-2-azaspiro[3.5]nonane-2-carboxylate is used as an ATX inhibitors which is useful in the treatment of cancers and fibrotic diseases |
| | tert-butyl 7-hydroxy-2-azaspiro[3.5]nonane-2-carboxylate Preparation Products And Raw materials |
|