|
|
| | (S)-N-FMoc-2-(6'-heptenyl)alanine Basic information |
| Product Name: | (S)-N-FMoc-2-(6'-heptenyl)alanine | | Synonyms: | (S)-2-((((9H-Fluoren-9-yl)Methoxy)carbonyl)aMino)-2-Methylnon-8-enoic acid;(9H-Fluoren-9-yl)MethOxy]Carbonyl Alpha-Methyl-Gly(Heptenyl)-OH;FMOC-(S)-2-(6-HEPTENYL)ALANINE;(S)-2-(Fmoc-amino)-2-methylnon-8-enoic acid;(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-2-methylnon-8-enoic acid;(S)-N-Fmoc-2-(6'-heptenyl)alanine, >97%;Fmoc-(S)-2-amino-2-methylnon-8-enoic acid;8-Nonenoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2-methyl-, (2S)- | | CAS: | 1311933-83-1 | | MF: | C25H29NO4 | | MW: | 407.5 | | EINECS: | | | Product Categories: | | | Mol File: | 1311933-83-1.mol |  |
| | (S)-N-FMoc-2-(6'-heptenyl)alanine Chemical Properties |
| Boiling point | 613.4±55.0 °C(Predicted) | | density | 1.154±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | form | Solid | | pka | 3.94±0.41(Predicted) | | color | Off-white to light yellow | | InChIKey | WSTJGDVRPQAMSC-VWLOTQADSA-N | | SMILES | C(O)(=O)[C@](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)(C)CCCCCC=C |
| | (S)-N-FMoc-2-(6'-heptenyl)alanine Usage And Synthesis |
| Uses | (S)-N-FMoc-2-(6'-heptenyl)alanine is a amino acid, which can be used in peptide synthesis[1]. | | References | [1] Karhu L, et al. Stapled truncated orexin peptides as orexin receptor agonists. Peptides. 2018 Apr;102:54-60. DOI:10.1016/j.peptides.2018.02.004 |
| | (S)-N-FMoc-2-(6'-heptenyl)alanine Preparation Products And Raw materials |
|