|
|
| | NSC 55712 Basic information |
| Product Name: | NSC 55712 | | Synonyms: | NSC 55712;TPT-260 (Dihydrochloride);THIOPHENE-2,5-DIYLBIS(METHYLENE) DICARBAMIMIDOTHIOATE.2HCL;TPT-260 (Dihydrochloride), NSC55712;TPT-260 2HCl;Carbamimidothioic acid 2,5-thiophenediylbis(methylene) ester dihydrochloride;TPT-260 , NSC55712;NSC 55712 Carbamimidothioic acid 2,5-thiophenediylbis(methylene) ester dihydrochloride | | CAS: | 2076-91-7 | | MF: | C8H14Cl2N4S3 | | MW: | 333.32456 | | EINECS: | | | Product Categories: | Inhibitors | | Mol File: | 2076-91-7.mol |  |
| | NSC 55712 Chemical Properties |
| Melting point | 210℃ (Decomposition) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO:62.5(Max Conc. mg/mL);240.02(Max Conc. mM) | | form | A crystalline solid | | color | Light yellow to yellow | | Water Solubility | water: 50mg/mL | | InChIKey | DSODRWWHAUGSGD-UHFFFAOYSA-N | | SMILES | [s]1c(ccc1CSC(=[N+H2])N)CSC(=[N+H2])N.[Cl-].[Cl-] |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | NSC 55712 Usage And Synthesis |
| Uses | Retromers are multiprotein complexes responsible for trafficking cargo out of endosomes. This is an important function that, in the case of amyloid-precursor protein (APP), is neuroprotective by preventing APP from being cleaved into Alzheimer’s disease-inducing fragments via the endosome. TPT-260 is a thiophene thiourea derivative that acts as a chaperone to stabilize the retromer complex against thermal denaturation (Kd = ~5 μM). In cultured hippocampal neurons, TPT-260 dose-dependently increases the level of retromer proteins, redirects APP from the endosome, and reduces the formation of pathogenic APP.[Cayman Chemical] | | Biological Activity | Cell permeable: yes', 'Primary Target
vacuolar protein sorting (Vps) proteins', 'Reversible: yes |
| | NSC 55712 Preparation Products And Raw materials |
|