Dimethyl ethylmalonate manufacturers
|
| | Dimethyl ethylmalonate Basic information |
| | Dimethyl ethylmalonate Chemical Properties |
| Boiling point | 188-190 °C (lit.) | | density | 1.066 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.418 | | Fp | 92 °C | | storage temp. | Storage temp. 2-8°C | | pka | 13.12±0.46(Predicted) | | Appearance | Colorless to light yellow Liquid | | BRN | 1769537 | | InChI | InChI=1S/C7H12O4/c1-4-5(6(8)10-2)7(9)11-3/h5H,4H2,1-3H3 | | InChIKey | XGRMVENQJLQMLT-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(CC)C(OC)=O | | CAS DataBase Reference | 26717-67-9(CAS DataBase Reference) | | NIST Chemistry Reference | Propanedioic acid, ethyl-, dimethyl ester(26717-67-9) |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | Dimethyl ethylmalonate Usage And Synthesis |
| Uses | Dimethyl 2-Ethylmalonate is a useful chemical in organic synthesis. | | Synthesis Reference(s) | Journal of the American Chemical Society, 102, p. 4973, 1980 DOI: 10.1021/ja00535a026 |
| | Dimethyl ethylmalonate Preparation Products And Raw materials |
|