(5S)-5-Methyl-2-Pyrrolidinone manufacturers
|
| | (5S)-5-Methyl-2-Pyrrolidinone Basic information |
| | (5S)-5-Methyl-2-Pyrrolidinone Chemical Properties |
| Boiling point | 240.5±9.0 °C(Predicted) | | density | 0.979±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 16.68±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C5H9NO/c1-4-2-3-5(7)6-4/h4H,2-3H2,1H3,(H,6,7)/t4-/m0/s1 | | InChIKey | YVIVRJLWYJGJTJ-BYPYZUCNSA-N | | SMILES | N1[C@@H](C)CCC1=O |
| | (5S)-5-Methyl-2-Pyrrolidinone Usage And Synthesis |
| Uses | (5S)-5-Methyl-2-Pyrrolidinone is used as a compound of chiral building blocks research chemicals. |
| | (5S)-5-Methyl-2-Pyrrolidinone Preparation Products And Raw materials |
|