|
|
| | 4,5-Dibromo-2-furaldehyde Basic information |
| Product Name: | 4,5-Dibromo-2-furaldehyde | | Synonyms: | 4,5-DIBROMO-2-FURALDEHYDE;4,5-DIBROMO-FURAN-2-CARBALDEHYDE;VITAS-BB TBB000315;4,5-DIBROMO-2-FURANCARBOXALDEHYDE;2-Furancarboxaldehyde, 4,5-dibromo-;4,5-Dibromofuran-2-carboxaldehyde | | CAS: | 2433-85-4 | | MF: | C5H2Br2O2 | | MW: | 253.88 | | EINECS: | | | Product Categories: | Furan&Benzofuran | | Mol File: | 2433-85-4.mol |  |
| | 4,5-Dibromo-2-furaldehyde Chemical Properties |
| Melting point | 36-37 °C | | Boiling point | 102-112 °C(Press: 8 Torr) | | density | 2.183±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | InChI | InChI=1S/C5H2Br2O2/c6-4-1-3(2-8)9-5(4)7/h1-2H | | InChIKey | CRHHCCZDQZBLPL-UHFFFAOYSA-N | | SMILES | O1C(Br)=C(Br)C=C1C=O | | CAS DataBase Reference | 2433-85-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2932190090 |
| | 4,5-Dibromo-2-furaldehyde Usage And Synthesis |
| | 4,5-Dibromo-2-furaldehyde Preparation Products And Raw materials |
|