|
|
| | 4-(Hydroxymethyl)phenoxyacetic acid Basic information |
| | 4-(Hydroxymethyl)phenoxyacetic acid Chemical Properties |
| Melting point | 112-114 °C | | Boiling point | 378.3±22.0 °C(Predicted) | | density | 1.316±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Crystalline Powder | | pka | 3.15±0.10(Predicted) | | color | Off-white | | biological source | rabbit | | BRN | 5260336 | | InChI | InChI=1S/C9H10O4/c10-5-7-1-3-8(4-2-7)13-6-9(11)12/h1-4,10H,5-6H2,(H,11,12) | | InChIKey | VUCNQOPCYRJCGQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)COC1=CC=C(CO)C=C1 | | CAS DataBase Reference | 68858-21-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36/37/39-27-26 | | WGK Germany | 3 | | F | 10 | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(Hydroxymethyl)phenoxyacetic acid Usage And Synthesis |
| Chemical Properties | Beige powder | | Uses | 4-(Hydroxymethyl)phenoxyacetic acid is a linkage agent used in solid-phase peptide synthesis according to the "FMOC-polyamide" technique. | | reaction suitability | reagent type: linker | | Synthesis | To a mixed solution of tetrahydrofuran ( 12 m L) and water ( 8 m L) of the precursor compound ester ( 312 mg , 1.48 mmol) was added lithium hydroxide (
109 mg, 4.46 mmol) in aqueous solution, the resulting mixture was stirred and reacted at room temperature for 2 h. Then the tetrahydrofuran was removed under vacuum, and the residue obtained was acidified with 5N
HCl acidified to make the reaction aqueous solution pH = 2 and extracted with EtOAc ( 3 20 m L ).
) was extracted, the combined organic layers were washed with brine, the organic layer was dried over sodium sulfate and then evaporated under vacuum to give 4-(hydroxymethyl)phenoxyacetic acid as a white solid in 89 % yield. |
| | 4-(Hydroxymethyl)phenoxyacetic acid Preparation Products And Raw materials |
|