| Company Name: |
Zhuo Ruining (Shanghai) Technology Co., Ltd Gold
|
| Tel: |
0086-18163338995; 18163338995 |
| Email: |
2605578685@qq.com |
| Products Intro: |
Product Name:4-iodoBenzenepentanoic acid
CAS:116680-98-9
Purity:97%+ Package:g，kg
|
| Company Name: |
Finetech Industry Limited
|
| Tel: |
027-87465837 19945049750 |
| Email: |
sales@finetechnology-ind.com |
| Products Intro: |
Product Name:5-(4-iodophenyl)pentanoic acid
CAS:116680-98-9
Purity:98% Package:1g;10g;25g;500g;1kg
|
| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 |
| Email: |
info@amateksci.com |
| Products Intro: |
Product Name:4-Iodo-benzenepentanoic acid
CAS:116680-98-9
Purity:97% HPLC Package:1g;5g;25g;100g
|
|
| | 4-iodoBenzenepentanoic acid Basic information |
| | 4-iodoBenzenepentanoic acid Chemical Properties |
| Melting point | 109.5-110.5 °C | | Boiling point | 386.9±25.0 °C(Predicted) | | density | 1.613±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 4.73±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H13IO2/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h5-8H,1-4H2,(H,13,14) | | InChIKey | AVVFIQYGBUOFDN-UHFFFAOYSA-N | | SMILES | C1(CCCCC(O)=O)=CC=C(I)C=C1 |
| | 4-iodoBenzenepentanoic acid Usage And Synthesis |
| | 4-iodoBenzenepentanoic acid Preparation Products And Raw materials |
|