|
|
| | Clindamycin 2,4-Diphosphate Basic information |
| Product Name: | Clindamycin 2,4-Diphosphate | | Synonyms: | Clindamycin 2,4-Diphosphate;methyl 7-chloro-6,7,8-trideoxy-6-[[[(2S,4R)-1-methyl-4-propylpyrrolidin-2-yl]carbonyl]amino]-2,4-di-O-phosphono-1-thio-L-threo-α-D-galacto-octopyranoside (clindamycin 2,4-bisphosphate);Clindamycin Impurity 18(Clindamycin Phosphate EP Impurity I);(2R,3R,4S,5R,6R)-2-(2-chloro-1;Clindamycin Phosphate EP Impurity I/Clindamycin 2,4-Diphosphate/methyl 7-chloro-6,7,8-trideoxy-6-[[[(2S,4R)-1-methyl-4-propylpyrrolidin-2-yl]carbonyl]amino]-2,4-di-O-phosphono-1-thio-L-threo-α-D-galacto-octopyranoside;Clindamycin Phosphate EP IMP I;Clindamycin phosphate Impurity I( Clindamycin 2,4-Diphosphate);Clindamycin Impurity I | | CAS: | 1309048-48-3 | | MF: | C18H35ClN2O11P2S | | MW: | 584.94 | | EINECS: | | | Product Categories: | | | Mol File: | 1309048-48-3.mol |  |
| | Clindamycin 2,4-Diphosphate Chemical Properties |
| solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic, Moisture Sensitive | | InChIKey | SPZJAFHRZHRDNU-GWOVNWBCNA-N | | SMILES | P(O[C@@H]1[C@H](O)[C@@H](OP(O)(O)=O)[C@@H](SC)O[C@@H]1[C@H](NC([C@@H]1C[C@@H](CCC)CN1C)=O)[C@@H](Cl)C)(O)(O)=O |&1:2,3,5,11,15,16,19,21,29,r| |
| | Clindamycin 2,4-Diphosphate Usage And Synthesis |
| Uses | Clindamycin 2,4-Diphosphate (Clindamycin Phosphate EP Impurity I) is an impurity of Clindamycin (C580000, HCl salt) which is a semi-synthetic antibiotic. |
| | Clindamycin 2,4-Diphosphate Preparation Products And Raw materials |
|