5-CHLORO-1,3-BENZODIOXOLE manufacturers
|
| | 5-CHLORO-1,3-BENZODIOXOLE Basic information |
| | 5-CHLORO-1,3-BENZODIOXOLE Chemical Properties |
| Boiling point | 185-187 °C(lit.) | | density | 1.34 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.556(lit.) | | Fp | 201 °F | | storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H5ClO2/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3H,4H2 | | InChIKey | ODQPZHOXLYATLC-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(Cl)C=C2OC1 | | CAS DataBase Reference | 7228-38-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-CHLORO-1,3-BENZODIOXOLE Usage And Synthesis |
| Uses | 5-Chloro-1,3-benzodioxole was converted into a safrole derivative via one-pot process involving two consecutive irradiations. | | General Description | 5-Chloro-1,3-benzodioxole was converted into a safrole derivative via one-pot process involving two consecutive irradiations. |
| | 5-CHLORO-1,3-BENZODIOXOLE Preparation Products And Raw materials |
|